Preferred Name |
Ketotifen |
|
Synonyms |
4-(1-methylpiperidin-4-ylidene)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one 10-(1-methyl-4-piperidinylidene)-5H-benzo[1,2]cyclohepta[3,4-b]thiophen-4-one ketotifenum ketotifen ketotifene ketotifeno |
|
Definitions |
An organic heterotricyclic compound that is 4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one which is substituted at position 4 by a 1-methylpiperidin-4-ylidene group. A blocker of histamine H1 receptors with a stabilising action on mast cells, it is used (usually as its hydrogen fumarate salt) for the treatment of asthma, where it may take several weeks to exert its full effect. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_92511 |
|
charge |
0 |
|
database_cross_reference |
CAS:34580-13-7 DrugBank:DB00920 KEGG:D08105 LINCS:LSM-2637 Patent:DE2111071 Drug_Central:1530 Patent:US3682930 Wikipedia:Ketotifen HMDB:HMDB0015056 |
|
formula |
C19H19NOS |
|
has role | ||
has_exact_synonym |
4-(1-methylpiperidin-4-ylidene)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
10-(1-methyl-4-piperidinylidene)-5H-benzo[1,2]cyclohepta[3,4-b]thiophen-4-one ketotifenum ketotifen ketotifene ketotifeno |
|
has_RxCUI |
6146 |
|
id |
CHEBI:92511 |
|
in_subset | ||
inchi |
InChI=1S/C19H19NOS/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19/h2-5,8,11H,6-7,9-10,12H2,1H3 |
|
inchikey |
ZCVMWBYGMWKGHF-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
ketotifen Ketotifen |
|
mass |
309.427 |
|
monoisotopicmass |
309.11874 |
|
notation |
CHEBI:92511 |
|
prefixIRI |
CHEBI:92511 |
|
prefLabel |
Ketotifen |
|
smiles |
CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1 |
|
textual definition |
An organic heterotricyclic compound that is 4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one which is substituted at position 4 by a 1-methylpiperidin-4-ylidene group. A blocker of histamine H1 receptors with a stabilising action on mast cells, it is used (usually as its hydrogen fumarate salt) for the treatment of asthma, where it may take several weeks to exert its full effect. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26979 http://purl.obolibrary.org/obo/CHEBI_78840 http://purl.obolibrary.org/obo/CHEBI_38106 http://purl.obolibrary.org/obo/CHEBI_3992 |