Preferred Name |
N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|
Synonyms |
N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|
Definitions |
An aromatic ether consisting of 4-trifluoromethylphenol in which the hydrogen of the phenolic hydroxy group is replaced by a 3-(methylamino)-1-phenylpropyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_86990 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-1449 VSDB:1851 |
|
formula |
C17H18F3NO |
|
has_exact_synonym |
N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:86990 |
|
in_subset | ||
inchi |
InChI=1S/C17H18F3NO/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20/h2-10,16,21H,11-12H2,1H3 |
|
inchikey |
RTHCYVBBDHJXIQ-UHFFFAOYSA-N |
|
label |
N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|
mass |
309.32610 |
|
monoisotopicmass |
309.13405 |
|
notation |
CHEBI:86990 |
|
prefLabel |
N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|
smiles |
CNCCC(Oc1ccc(cc1)C(F)(F)F)c1ccccc1 |
|
textual definition |
An aromatic ether consisting of 4-trifluoromethylphenol in which the hydrogen of the phenolic hydroxy group is replaced by a 3-(methylamino)-1-phenylpropyl group. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |