loading...| Preferred Name |
Proguanil |
|
| Synonyms |
N-(4-chlorophenyl)-N'-(propan-2-yl)imidodicarbonimidic diamide proguanilum Chlorguanide 1-(p-chlorophenyl)-5-isopropylbiguanide Chloroguanide N-(4-Chlorophenyl)-N'-(isopropyl)-imidodicarbonimidic diamide proguanil |
|
| Definitions |
A biguanide compound which has isopropyl and p-chlorophenyl substituents on the terminal N atoms. A prophylactic antimalarial drug, it works by inhibiting the enzyme dihydrofolate reductase, which is involved in the reproduction of the malaria parasites Plasmodium falciparum and P. vivax within the red blood cells. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8455 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01131 Drug_Central:2282 PMID:8866915 PMID:10348748 PMID:10848923 KEGG:C07631 KEGG:D08428 CAS:500-92-5 Beilstein:2811599 Wikipedia:Proguanil Reaxys:2811599 LINCS:LSM-2618 HMDB:HMDB0015263 PMID:15504827 |
|
| formula |
C11H16ClN5 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50683 |
|
| has_exact_synonym |
N-(4-chlorophenyl)-N'-(propan-2-yl)imidodicarbonimidic diamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
proguanilum Chlorguanide 1-(p-chlorophenyl)-5-isopropylbiguanide Chloroguanide N-(4-Chlorophenyl)-N'-(isopropyl)-imidodicarbonimidic diamide proguanil |
|
| has_RxCUI |
2382 |
|
| id |
CHEBI:8455 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H16ClN5/c1-7(2)15-10(13)17-11(14)16-9-5-3-8(12)4-6-9/h3-7H,1-2H3,(H5,13,14,15,16,17) |
|
| inchikey |
SSOLNOMRVKKSON-UHFFFAOYSA-N |
|
| is bearer of | ||
| label |
proguanil Proguanil |
|
| mass |
253.73100 |
|
| monoisotopicmass |
253.10942 |
|
| notation |
CHEBI:8455 |
|
| prefixIRI |
CHEBI:8455 |
|
| prefLabel |
Proguanil |
|
| smiles |
CC(C)NC(=N)NC(=N)Nc1ccc(Cl)cc1 |
|
| textual definition |
A biguanide compound which has isopropyl and p-chlorophenyl substituents on the terminal N atoms. A prophylactic antimalarial drug, it works by inhibiting the enzyme dihydrofolate reductase, which is involved in the reproduction of the malaria parasites Plasmodium falciparum and P. vivax within the red blood cells. |
|
| subClassOf |