Preferred Name |
varenicline |
|
Synonyms |
7,8,9,10-tetrahydro-6H-6,10-methanoazepino[4,5-g]quinoxaline vareniclinum vareniclina varenicline 7,8,9,10-Tetrahydro-6,10-methano-6H-pyrazino(2,3-h)(3)benzazepine |
|
Definitions |
An organic heterotetracyclic compound that acts as a partial agonist for nicotinic cholinergic receptors and is used (in the form of its tartate salt) as an aid to giving up smoking. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_84500 |
|
charge |
0 |
|
database_cross_reference |
PMID:25475645 PMID:25352081 PMID:25462656 PMID:25572451 PMID:24906297 Drug_Central:2808 PMID:24856597 PMID:25145377 PMID:24763764 Reaxys:10668886 KEGG:D08669 LINCS:LSM-5358 PMID:25331778 PMID:25449275 DrugBank:DB01273 PMID:24949564 HMDB:HMDB0015398 CAS:249296-44-4 PDBeChem:QMR PMID:25485645 PMID:25062287 PMID:25588294 Wikipedia:Varenicline PMID:24652107 PMID:25410148 PMID:25616031 PMID:24406270 PMID:25497715 |
|
formula |
C13H13N3 |
|
has role | ||
has_exact_synonym |
7,8,9,10-tetrahydro-6H-6,10-methanoazepino[4,5-g]quinoxaline |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
vareniclinum vareniclina varenicline 7,8,9,10-Tetrahydro-6,10-methano-6H-pyrazino(2,3-h)(3)benzazepine |
|
has_RxCUI |
591622 |
|
id |
CHEBI:84500 |
|
in_subset | ||
inchi |
InChI=1S/C13H13N3/c1-2-16-13-5-11-9-3-8(6-14-7-9)10(11)4-12(13)15-1/h1-2,4-5,8-9,14H,3,6-7H2/t8-,9+ |
|
inchikey |
JQSHBVHOMNKWFT-DTORHVGOSA-N |
|
is conjugate base of | ||
label |
varenicline |
|
mass |
211.26240 |
|
monoisotopicmass |
211.11095 |
|
notation |
CHEBI:84500 |
|
prefixIRI |
CHEBI:84500 |
|
prefLabel |
varenicline |
|
smiles |
C1[C@H]2CNC[C@@H]1c1cc3nccnc3cc21 |
|
textual definition |
An organic heterotetracyclic compound that acts as a partial agonist for nicotinic cholinergic receptors and is used (in the form of its tartate salt) as an aid to giving up smoking. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 |