Preferred Name |
olaparib |
|
Synonyms |
AZD-2281 AZD2281 KU59436 Lynparza olaparib 4-(3-{[4-(cyclopropylcarbonyl)piperazin-1-yl]carbonyl}-4-fluorobenzyl)phthalazin-1(2H)-one |
|
Definitions |
A member of the class of N-acylpiperazines obtained by formal condensation of the carboxy group of 2-fluoro-5-[(4-oxo-3,4-dihydrophthalazin-1-yl)methyl]benzoic acid with the free amino group of N-(cyclpropylcarbonyl)piperazine; used to treat advanced ovarian cancer. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_83766 |
|
alternative term |
AZD-2281 AZD2281 KU59436 Lynparza olaparib 4-(3-{[4-(cyclopropylcarbonyl)piperazin-1-yl]carbonyl}-4-fluorobenzyl)phthalazin-1(2H)-one |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-1145 Wikipedia:Olaparib PMID:25025963 PMID:24827126 PMID:25275045 PMID:24694947 PMID:24826054 PMID:25072752 PDBeChem:09L PMID:24817481 PMID:24700236 PMID:24534203 KEGG:D09730 PMID:24038812 PMID:25573533 Reaxys:12051534 PMID:25483710 PMID:22454224 PMID:24631446 PMID:25566684 PMID:25404465 Drug_Central:4907 PMID:25218906 CAS:763113-22-0 PMID:24356813 PMID:25139258 PMID:24577941 PMID:18800822 PMID:25531448 |
|
formula |
C24H23FN4O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
has_exact_synonym |
4-(3-{[4-(cyclopropylcarbonyl)piperazin-1-yl]carbonyl}-4-fluorobenzyl)phthalazin-1(2H)-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
AZD-2281 AZD2281 KU59436 Lynparza olaparib |
|
has_RxCUI |
1597582 |
|
id |
CHEBI:83766 |
|
in_subset | ||
inchi |
InChI=1S/C24H23FN4O3/c25-20-8-5-15(14-21-17-3-1-2-4-18(17)22(30)27-26-21)13-19(20)24(32)29-11-9-28(10-12-29)23(31)16-6-7-16/h1-5,8,13,16H,6-7,9-12,14H2,(H,27,30) |
|
inchikey |
FDLYAMZZIXQODN-UHFFFAOYSA-N |
|
label |
olaparib |
|
mass |
434.46280 |
|
monoisotopicmass |
434.17542 |
|
notation |
CHEBI:83766 |
|
prefixIRI |
CHEBI:83766 |
|
prefLabel |
olaparib |
|
smiles |
Fc1ccc(Cc2n[nH]c(=O)c3ccccc23)cc1C(=O)N1CCN(CC1)C(=O)C1CC1 |
|
textual definition |
A member of the class of N-acylpiperazines obtained by formal condensation of the carboxy group of 2-fluoro-5-[(4-oxo-3,4-dihydrophthalazin-1-yl)methyl]benzoic acid with the free amino group of N-(cyclpropylcarbonyl)piperazine; used to treat advanced ovarian cancer. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38768 http://purl.obolibrary.org/obo/CHEBI_46844 |