Preferred Name |
Pipobroman |
|
Synonyms |
1,1'-piperazine-1,4-diylbis(3-bromopropan-1-one) 1,4-bis(3-bromopropionyl)piperazine N,N-bis-(3-bromopropionyl)-piperazine pipobromanum A 8103 A-8103 Amedel Vercyte pipobroman |
|
Definitions |
An N-acylpiperazine that is piperazine in which each of the nitrogens has been acylated by a 3-bromopropionoyl group. An anti-cancer drug. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8242 |
|
charge |
0 |
|
database_cross_reference |
PMID:11886392 PMID:26854489 PMID:5298493 PMID:12764352 DrugBank:DB00236 Patent:DE1138781 Drug_Central:2192 PMID:5228673 PMID:21911721 HMDB:HMDB0014381 PMID:19633773 PMID:16425025 PMID:14565648 PMID:17657187 PMID:28688466 KEGG:D00467 PMID:11025590 KEGG:C07362 CAS:54-91-1 PMID:15175894 PMID:11736962 PMID:7746823 PMID:16810617 Wikipedia:Pipobroman |
|
formula |
C10H16Br2N2O2 |
|
has role | ||
has_exact_synonym |
1,1'-piperazine-1,4-diylbis(3-bromopropan-1-one) |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,4-bis(3-bromopropionyl)piperazine N,N-bis-(3-bromopropionyl)-piperazine pipobromanum A 8103 A-8103 Amedel Vercyte pipobroman |
|
has_RxCUI |
8347 |
|
id |
CHEBI:8242 |
|
in_subset | ||
inchi |
InChI=1S/C10H16Br2N2O2/c11-3-1-9(15)13-5-7-14(8-6-13)10(16)2-4-12/h1-8H2 |
|
inchikey |
NJBFOOCLYDNZJN-UHFFFAOYSA-N |
|
label |
pipobroman Pipobroman |
|
mass |
356.054 |
|
monoisotopicmass |
353.95785 |
|
notation |
CHEBI:8242 |
|
prefixIRI |
CHEBI:8242 |
|
prefLabel |
Pipobroman |
|
smiles |
N1(CCN(CC1)C(CCBr)=O)C(=O)CCBr |
|
textual definition |
An N-acylpiperazine that is piperazine in which each of the nitrogens has been acylated by a 3-bromopropionoyl group. An anti-cancer drug. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46844 |