loading...| Preferred Name |
piperonal |
|
| Synonyms |
piperonaldehyde protocatechuic aldehyde methylene ether piperonyl aldehyde heliotropin 3,4-methylenedioxybenzaldehyde 3,4-(methylenedioxy)benzaldehyde 3,4-dihydroxybenzaldehyde methylene ketal 1,3-benzodioxole-5-carboxaldehyde 5-formyl-1,3-benzodioxole piperonylaldehyde heliotropine 1,3-benzodioxole-5-carbaldehyde Piperonal piperonal |
|
| Definitions |
An arenecarbaldehyde that is 1,3-benzodioxole substituted by a formyl substituent at position 5. It has been isolated from Piper nigrum. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8240 |
|
| alternative term |
piperonaldehyde protocatechuic aldehyde methylene ether piperonyl aldehyde heliotropin 3,4-methylenedioxybenzaldehyde 3,4-(methylenedioxy)benzaldehyde 3,4-dihydroxybenzaldehyde methylene ketal 1,3-benzodioxole-5-carboxaldehyde 5-formyl-1,3-benzodioxole piperonylaldehyde heliotropine 1,3-benzodioxole-5-carbaldehyde Piperonal piperonal |
|
| bearer_of |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:120-57-0 Patent:EP1253147 KEGG:C10812 Wikipedia:Piperonal PMID:6730989 Beilstein:131691 Reaxys:131691 KNApSAcK:C00002666 PMID:23711775 HMDB:HMDB0032612 PMID:21854175 Gmelin:4186 PMID:8308845 Patent:WO0157016 Patent:EP0429316 |
|
| formula |
C8H6O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_exact_synonym |
1,3-benzodioxole-5-carbaldehyde Piperonal piperonal |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
piperonaldehyde protocatechuic aldehyde methylene ether piperonyl aldehyde heliotropin 3,4-methylenedioxybenzaldehyde 3,4-(methylenedioxy)benzaldehyde 3,4-dihydroxybenzaldehyde methylene ketal 1,3-benzodioxole-5-carboxaldehyde 5-formyl-1,3-benzodioxole piperonylaldehyde heliotropine |
|
| has_RxCUI |
33753 |
|
| id |
CHEBI:8240 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H6O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-4H,5H2 |
|
| inchikey |
SATCULPHIDQDRE-UHFFFAOYSA-N |
|
| label |
piperonal |
|
| mass |
150.13144 |
|
| monoisotopicmass |
150.03169 |
|
| notation |
CHEBI:8240 |
|
| prefixIRI |
CHEBI:8240 |
|
| prefLabel |
piperonal |
|
| smiles |
[H]C(=O)c1ccc2OCOc2c1 |
|
| textual definition |
An arenecarbaldehyde that is 1,3-benzodioxole substituted by a formyl substituent at position 5. It has been isolated from Piper nigrum. |
|
| subClassOf |