loading...| Preferred Name |
Phenylpropanolamine |
|
| Synonyms |
beta-hydroxyamphetamine phenylpropanolaminum fenilpropanolamina phenylpropanolamine norephedrine PPA (1R,2R)-2-amino-1-phenylpropan-1-ol |
|
| Definitions |
An amphetamine in which the parent 1-phenylpropan-2-amine skeleton is substituted at position 1 with an hydroxy group. A decongestant and appetite suppressant, it is commonly used in prescription and over-the-counter cough and cold preparations. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8104 |
|
| alternative term |
beta-hydroxyamphetamine phenylpropanolaminum fenilpropanolamina phenylpropanolamine norephedrine PPA (1R,2R)-2-amino-1-phenylpropan-1-ol |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
CAS:14838-15-4 Drug_Central:2149 Reaxys:3196918 KEGG:D08368 PMID:29438107 |
|
| formula |
C9H13NO |
|
| has role | ||
| has_exact_synonym |
(1R,2R)-2-amino-1-phenylpropan-1-ol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
beta-hydroxyamphetamine phenylpropanolaminum fenilpropanolamina phenylpropanolamine norephedrine PPA |
|
| has_RxCUI |
8175 |
|
| id |
CHEBI:8104 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m1/s1 |
|
| inchikey |
DLNKOYKMWOXYQA-APPZFPTMSA-N |
|
| label |
phenylpropanolamine Phenylpropanolamine |
|
| mass |
151.206 |
|
| monoisotopicmass |
151.09971 |
|
| notation |
CHEBI:8104 |
|
| prefixIRI |
CHEBI:8104 |
|
| prefLabel |
Phenylpropanolamine |
|
| smiles |
C1=CC=CC(=C1)[C@H]([C@H](N)C)O |
|
| textual definition |
An amphetamine in which the parent 1-phenylpropan-2-amine skeleton is substituted at position 1 with an hydroxy group. A decongestant and appetite suppressant, it is commonly used in prescription and over-the-counter cough and cold preparations. |
|
| subClassOf |