Preferred Name |
tripalmitin |
|
Synonyms |
Glyceryl trihexadecanoate tripalmitoylglycerol 1,2,3-trihexadecanoylglycerol Palmitic acid triglycerin ester TG 16:0/16:0/16:0 Triglyceryl palmitate Palmitic triglyceride Hexadecanoic acid, 1,2,3-propanetriyl ester Glycerin tripalmitate Glycerol tripalmitate trihexadecanoylglycerol TG(16:0/16:0/16:0) Glyceryl tripalmitate 1,2,3-Propanetriol trihexadecanoate 1,2,3-propanetriyl trihexadecanoate propane-1,2,3-triyl trihexadecanoate |
|
Definitions |
A triglyceride obtained by formal acylation of the three hydroxy groups of glycerol by palmitic (hexadecanoic) acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_77393 |
|
alternative term |
Glyceryl trihexadecanoate tripalmitoylglycerol 1,2,3-trihexadecanoylglycerol Palmitic acid triglycerin ester TG 16:0/16:0/16:0 Triglyceryl palmitate Palmitic triglyceride Hexadecanoic acid, 1,2,3-propanetriyl ester Glycerin tripalmitate Glycerol tripalmitate trihexadecanoylglycerol TG(16:0/16:0/16:0) Glyceryl tripalmitate 1,2,3-Propanetriol trihexadecanoate 1,2,3-propanetriyl trihexadecanoate propane-1,2,3-triyl trihexadecanoate |
|
charge |
0 |
|
database_cross_reference |
Beilstein:1811188 HMDB:HMDB0005356 LIPID_MAPS_instance:LMGL03010001 CAS:555-44-2 PMID:21740098 PMID:22360498 Reaxys:1811188 |
|
formula |
C51H98O6 |
|
has functional parent | ||
has_exact_synonym |
propane-1,2,3-triyl trihexadecanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Glyceryl trihexadecanoate tripalmitoylglycerol 1,2,3-trihexadecanoylglycerol Palmitic acid triglycerin ester TG 16:0/16:0/16:0 Triglyceryl palmitate Palmitic triglyceride Hexadecanoic acid, 1,2,3-propanetriyl ester Glycerin tripalmitate Glycerol tripalmitate trihexadecanoylglycerol TG(16:0/16:0/16:0) Glyceryl tripalmitate 1,2,3-Propanetriol trihexadecanoate 1,2,3-propanetriyl trihexadecanoate |
|
has_RxCUI |
1368169 |
|
id |
CHEBI:77393 |
|
in_subset | ||
inchi |
InChI=1S/C51H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-49(52)55-46-48(57-51(54)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h48H,4-47H2,1-3H3 |
|
inchikey |
PVNIQBQSYATKKL-UHFFFAOYSA-N |
|
label |
tripalmitin |
|
mass |
807.32020 |
|
monoisotopicmass |
806.73634 |
|
notation |
CHEBI:77393 |
|
prefixIRI |
CHEBI:77393 |
|
prefLabel |
tripalmitin |
|
smiles |
CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC |
|
textual definition |
A triglyceride obtained by formal acylation of the three hydroxy groups of glycerol by palmitic (hexadecanoic) acid. |
|
subClassOf |