Preferred Name |
vilanterol |
|
Synonyms |
4-{(1R)-2-[(6-{2-[(2,6-dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol vilanterolum GW-642444x GW642444x vilanterol |
|
Definitions |
An dichlorobenzene derivative that is used in the form of its trifenate salt for treatment of chronic obstructive pulmonary disease. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_75037 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:11820500 PMID:23348973 KEGG:D09696 PMID:23830094 Wikipedia:Vilanterol PMID:22955035 CAS:503068-34-6 PMID:23284643 Drug_Central:4799 PMID:22241764 PMID:23569370 PMID:23043183 |
|
formula |
C24H33Cl2NO5 |
|
has role | ||
has_exact_synonym |
4-{(1R)-2-[(6-{2-[(2,6-dichlorobenzyl)oxy]ethoxy}hexyl)amino]-1-hydroxyethyl}-2-(hydroxymethyl)phenol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
vilanterolum GW-642444x GW642444x vilanterol |
|
has_RxCUI |
1424884 |
|
id |
CHEBI:75037 |
|
in_subset | ||
inchi |
InChI=1S/C24H33Cl2NO5/c25-21-6-5-7-22(26)20(21)17-32-13-12-31-11-4-2-1-3-10-27-15-24(30)18-8-9-23(29)19(14-18)16-28/h5-9,14,24,27-30H,1-4,10-13,15-17H2/t24-/m0/s1 |
|
inchikey |
DAFYYTQWSAWIGS-DEOSSOPVSA-N |
|
is conjugate base of | ||
label |
vilanterol |
|
mass |
486.42900 |
|
monoisotopicmass |
485.17358 |
|
notation |
CHEBI:75037 |
|
prefixIRI |
CHEBI:75037 |
|
prefLabel |
vilanterol |
|
smiles |
OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCOCc1c(Cl)cccc1Cl |
|
textual definition |
An dichlorobenzene derivative that is used in the form of its trifenate salt for treatment of chronic obstructive pulmonary disease. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 http://purl.obolibrary.org/obo/CHEBI_33853 http://purl.obolibrary.org/obo/CHEBI_25698 |