loading...| Preferred Name |
Dextromoramide |
|
| Synonyms |
(3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenyl-1-(pyrrolidin-1-yl)butan-1-one pyrrolamidolum (+)-3-methyl-4-morpholino-2,2-diphenyl-1-(pyrrolidin-1-yl)butanone dextromoramidum dextromoramida (+)-2,2-diphenyl-3-methyl-4-morpholinobutyrylpyrrolidine dextromoramide R 875 SKF 5137 SKF-5137 palfium palphium |
|
| Definitions |
An N-acylpyrrolidine arising by formal condensation of pyrrolidine with (3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenylbutanoic acid. An opioid analgesic that is structurally related to methadone, it is more poweful than morphine but shorter acting. It has been used (particularly as the hydrogen tartrate salt) for the treatment of severe pain, but was discontinued in the UK in 2004. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_74274 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D07287 PMID:7632606 PMID:2295688 PMID:13757828 Patent:GB822055 PMID:9584342 Reaxys:96553 CAS:357-56-2 Drug_Central:843 DrugBank:DB01529 PMID:8931067 PMID:89885 |
|
| formula |
C25H32N2O2 |
|
| has role | ||
| has_exact_synonym |
(3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenyl-1-(pyrrolidin-1-yl)butan-1-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pyrrolamidolum (+)-3-methyl-4-morpholino-2,2-diphenyl-1-(pyrrolidin-1-yl)butanone dextromoramidum dextromoramida (+)-2,2-diphenyl-3-methyl-4-morpholinobutyrylpyrrolidine dextromoramide R 875 SKF 5137 SKF-5137 palfium palphium |
|
| has_RxCUI |
3290 |
|
| id |
CHEBI:74274 |
|
| in_subset | ||
| inchi |
InChI=1S/C25H32N2O2/c1-21(20-26-16-18-29-19-17-26)25(22-10-4-2-5-11-22,23-12-6-3-7-13-23)24(28)27-14-8-9-15-27/h2-7,10-13,21H,8-9,14-20H2,1H3/t21-/m1/s1 |
|
| inchikey |
INUNXTSAACVKJS-OAQYLSRUSA-N |
|
| is bearer of | ||
| label |
dextromoramide Dextromoramide |
|
| mass |
392.53380 |
|
| monoisotopicmass |
392.24638 |
|
| notation |
CHEBI:74274 |
|
| prefixIRI |
CHEBI:74274 |
|
| prefLabel |
Dextromoramide |
|
| smiles |
C[C@H](CN1CCOCC1)C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1 |
|
| textual definition |
An N-acylpyrrolidine arising by formal condensation of pyrrolidine with (3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenylbutanoic acid. An opioid analgesic that is structurally related to methadone, it is more poweful than morphine but shorter acting. It has been used (particularly as the hydrogen tartrate salt) for the treatment of severe pain, but was discontinued in the UK in 2004. |
|
| subClassOf |