loading...| Preferred Name |
Ospemifene |
|
| Synonyms |
2-{4-[(1Z)-4-chloro-1,2-diphenylbut-1-en-1-yl]phenoxy}ethanol ospemifene 2-(4-(4-Chloro-1,2-diphenyl-but-1-enyl)phenoxy)ethanol 2-(p-((Z)-4-Chloro-1,2-diphenyl-1-butenyl)phenoxy)ethanol Deamino-hydroxytoremifene FC-1271a Fc-1271 Osphena |
|
| Definitions |
An organochlorine compound that is a selective estrogen receptor modulator; used for treatment of dyspareunia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_73275 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:19182697 Wikipedia:Ospemifene PMID:19533603 Reaxys:10283864 Patent:WO2005105052 Patent:US2005182143 PMID:20485909 PMID:10845810 PMID:20073065 Patent:US2008207956 PMID:20429673 PMID:19857095 Patent:US2011015448 PMID:23361170 PMID:22011753 Patent:EP2275098 KEGG:D08958 Patent:WO2010107475 PMID:20107426 PMID:21654612 CAS:128607-22-7 PMID:23096251 PMID:11457665 Patent:US2005187301 Patent:US2005187302 PMID:21564348 PMID:21926925 Patent:CN101636372 PMID:19466874 PMID:20032798 PMID:23332519 PMID:22196312 Drug_Central:4749 PMID:23062036 Patent:EP2286806 |
|
| formula |
C24H23ClO2 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| has_exact_synonym |
2-{4-[(1Z)-4-chloro-1,2-diphenylbut-1-en-1-yl]phenoxy}ethanol ospemifene |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(4-(4-Chloro-1,2-diphenyl-but-1-enyl)phenoxy)ethanol 2-(p-((Z)-4-Chloro-1,2-diphenyl-1-butenyl)phenoxy)ethanol Deamino-hydroxytoremifene FC-1271a Fc-1271 Osphena |
|
| has_RxCUI |
1370971 |
|
| id |
CHEBI:73275 |
|
| in_subset | ||
| inchi |
InChI=1S/C24H23ClO2/c25-16-15-23(19-7-3-1-4-8-19)24(20-9-5-2-6-10-20)21-11-13-22(14-12-21)27-18-17-26/h1-14,26H,15-18H2/b24-23- |
|
| inchikey |
LUMKNAVTFCDUIE-VHXPQNKSSA-N |
|
| label |
ospemifene Ospemifene |
|
| mass |
378.89100 |
|
| monoisotopicmass |
378.13866 |
|
| notation |
CHEBI:73275 |
|
| prefixIRI |
CHEBI:73275 |
|
| prefLabel |
Ospemifene |
|
| smiles |
OCCOc1ccc(cc1)C(\c1ccccc1)=C(\CCCl)c1ccccc1 |
|
| textual definition |
An organochlorine compound that is a selective estrogen receptor modulator; used for treatment of dyspareunia. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |