loading...| Preferred Name |
apixaban |
|
| Synonyms |
1-(4-methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine-3-carboxamide BMS-562247-01 BMS 562247-01 BMS-562247 Eliquis apixaban apixabanum |
|
| Definitions |
A pyrazolopyridine that is 7-oxo-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine-3-carboxamide substituted at position 1 by a 4-methoxyphenyl group and at position 6 by a 4-(2-oxopiperidin-1-yl)phenyl group. It is used for the prevention and treatment of thromboembolic diseases. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_72296 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23337923 PMID:22398784 PMID:23305476 PMID:23218999 PMID:23344716 PMID:22759198 PMID:23043068 Patent:US2007259913 PMID:21954450 PMID:23292264 PMID:21985171 PMID:23342716 Wikipedia:Apixaban PMID:23179181 Reaxys:11244786 PMID:21318583 PMID:23212107 DrugBank:DB06605 PMID:22686618 PMID:23033347 PMID:23351997 Patent:WO2008031782 Patent:WO2007022165 PMID:22250655 PMID:23292752 Patent:WO2010030983 KEGG:D03213 PDBeChem:GG2 CAS:503612-47-3 PMID:23312927 |
|
| formula |
C25H25N5O4 |
|
| has role | ||
| has_exact_synonym |
1-(4-methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine-3-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
BMS-562247-01 BMS 562247-01 BMS-562247 Eliquis apixaban apixabanum |
|
| has_RxCUI |
1364430 |
|
| id |
CHEBI:72296 |
|
| in_subset | ||
| inchi |
InChI=1S/C25H25N5O4/c1-34-19-11-9-18(10-12-19)30-23-20(22(27-30)24(26)32)13-15-29(25(23)33)17-7-5-16(6-8-17)28-14-3-2-4-21(28)31/h5-12H,2-4,13-15H2,1H3,(H2,26,32) |
|
| inchikey |
QNZCBYKSOIHPEH-UHFFFAOYSA-N |
|
| label |
apixaban |
|
| mass |
459.49710 |
|
| monoisotopicmass |
459.19065 |
|
| notation |
CHEBI:72296 |
|
| prefixIRI |
CHEBI:72296 |
|
| prefLabel |
apixaban |
|
| smiles |
COc1ccc(cc1)-n1nc(C(N)=O)c2CCN(C(=O)c12)c1ccc(cc1)N1CCCCC1=O |
|
| textual definition |
A pyrazolopyridine that is 7-oxo-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine-3-carboxamide substituted at position 1 by a 4-methoxyphenyl group and at position 6 by a 4-(2-oxopiperidin-1-yl)phenyl group. It is used for the prevention and treatment of thromboembolic diseases. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_24995 |