loading...| Preferred Name |
Midodrine |
|
| Synonyms |
rac-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]glycinamide DL-N1-(beta-Hydroxy-2,5-dimethoxyphenethyl)glycinamid 1-(2',5'-Dimethoxyphenyl)-2-glycinamidoethanol 2-Amino-N-(2,5-dimethoxy-beta-hydroxyphenethyl)acetamide (+-)-2-amino-N-(beta-hydroxy-2,5-dimethoxyphenethyl)acetamide midodrina midodrine midodrinum |
|
| Definitions |
An aromatic ether that is 1,4-dimethoxybenzene which is substituted at position 2 by a 2-(glycylamino)-1-hydroxyethyl group. A direct-acting sympathomimetic with selective alpha-adrenergic agonist activity, it is used (generally as its hydrochloride salt) as a peripheral vasoconstrictor in the treatment of certain hypotensive states. The main active moiety is its major metabolite, deglymidodrine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6933 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21343575 Patent:US3340298 PMID:16676655 PMID:15273244 HMDB:HMDB0014356 PMID:18840368 PMID:17901021 KEGG:D08220 PMID:20376815 Wikipedia:Midodrine Reaxys:2384653 Patent:GB1003659 CAS:42794-76-3 DrugBank:DB00211 PMID:11096750 KEGG:C07890 PMID:23051063 LINCS:LSM-1815 PMID:22436941 PMID:18410283 Drug_Central:1803 Beilstein:2384653 PMID:20844343 PMID:19522958 PMID:21801220 |
|
| formula |
C12H18N2O4 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35569 |
|
| has_exact_synonym |
rac-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]glycinamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
DL-N1-(beta-Hydroxy-2,5-dimethoxyphenethyl)glycinamid 1-(2',5'-Dimethoxyphenyl)-2-glycinamidoethanol 2-Amino-N-(2,5-dimethoxy-beta-hydroxyphenethyl)acetamide (+-)-2-amino-N-(beta-hydroxy-2,5-dimethoxyphenethyl)acetamide midodrina midodrine midodrinum |
|
| has_RxCUI |
6963 |
|
| id |
CHEBI:6933 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H18N2O4/c1-17-8-3-4-11(18-2)9(5-8)10(15)7-14-12(16)6-13/h3-5,10,15H,6-7,13H2,1-2H3,(H,14,16) |
|
| inchikey |
PTKSEFOSCHHMPD-UHFFFAOYSA-N |
|
| is bearer of | ||
| is conjugate base of | ||
| label |
midodrine Midodrine |
|
| mass |
254.28230 |
|
| monoisotopicmass |
254.12666 |
|
| notation |
CHEBI:6933 |
|
| prefixIRI |
CHEBI:6933 |
|
| prefLabel |
Midodrine |
|
| smiles |
COc1ccc(OC)c(c1)C(O)CNC(=O)CN |
|
| textual definition |
An aromatic ether that is 1,4-dimethoxybenzene which is substituted at position 2 by a 2-(glycylamino)-1-hydroxyethyl group. A direct-acting sympathomimetic with selective alpha-adrenergic agonist activity, it is used (generally as its hydrochloride salt) as a peripheral vasoconstrictor in the treatment of certain hypotensive states. The main active moiety is its major metabolite, deglymidodrine. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |