Preferred Name |
Mexiletine |
|
Synonyms |
1-(2,6-dimethylphenoxy)propan-2-amine Mexiletine (2RS)-1-(2,6-dimethylphenoxy)-2-aminopropane 1-(2',6'-dimethylphenoxy)-2-aminopropane 1-methyl-2-(2,6-xylyloxy)ethanamine 1-(2,6-dimethylphenoxy)-2-propanamine (+-)-1-(2,6-dimethylphenoxy)propan-2-amine mexiletinum mexiletina mexiletine |
|
Definitions |
An aromatic ether which is 2,6-dimethylphenyl ether of 2-aminopropan-1-ol. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6916 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00379 Patent:FR1551055 KEGG:C07220 PMID:10883344 PMID:11009230 Drug_Central:1794 Wikipedia:Mexiletine HMDB:HMDB0014523 CAS:31828-71-4 Reaxys:2092205 KEGG:D08215 Patent:US3954872 LINCS:LSM-1700 |
|
formula |
C11H17NO |
|
has role | ||
has_alternative_id |
CHEBI:115958 |
|
has_exact_synonym |
1-(2,6-dimethylphenoxy)propan-2-amine Mexiletine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(2RS)-1-(2,6-dimethylphenoxy)-2-aminopropane 1-(2',6'-dimethylphenoxy)-2-aminopropane 1-methyl-2-(2,6-xylyloxy)ethanamine 1-(2,6-dimethylphenoxy)-2-propanamine (+-)-1-(2,6-dimethylphenoxy)propan-2-amine mexiletinum mexiletina mexiletine |
|
has_RxCUI |
6926 |
|
id |
CHEBI:6916 |
|
in_subset | ||
inchi |
InChI=1S/C11H17NO/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6,10H,7,12H2,1-3H3 |
|
inchikey |
VLPIATFUUWWMKC-UHFFFAOYSA-N |
|
is bearer of | ||
label |
Mexiletine mexiletine |
|
mass |
179.25880 |
|
monoisotopicmass |
179.13101 |
|
notation |
CHEBI:6916 |
|
prefixIRI |
CHEBI:6916 |
|
prefLabel |
Mexiletine |
|
smiles |
CC(N)COc1c(C)cccc1C |
|
textual definition |
An aromatic ether which is 2,6-dimethylphenyl ether of 2-aminopropan-1-ol. |
|
subClassOf |