loading...| Preferred Name |
Metipranolol |
|
| Synonyms |
Metipranolol 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2,3,6-trimethylphenyl acetate metipranolol metipranololum Acetic acid 4-(2-hydroxy-3-isopropylamino-propoxy)-2,3,6-trimethyl-phenyl ester (+-)-metipranolol |
|
| Definitions |
3-(Propan-2-ylamino)propane-1,2-diol in which the hydrogen of the primary hydroxy group is substituted by a 4-acetoxy-2,3,5-trimethylphenoxy group. A non-cardioselective beta-blocker, it is used to lower intra-ocular pressure in the management of open-angle glaucoma. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6897 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01214 CAS:22664-55-7 Reaxys:2152010 Drug_Central:1779 Wikipedia:Metipranolol KEGG:C07915 KEGG:D02374 |
|
| formula |
C17H27NO4 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_39456 http://purl.obolibrary.org/obo/CHEBI_38070 |
|
| has_alternative_id |
CHEBI:355221 |
|
| has_exact_synonym |
Metipranolol 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-2,3,6-trimethylphenyl acetate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
metipranolol metipranololum Acetic acid 4-(2-hydroxy-3-isopropylamino-propoxy)-2,3,6-trimethyl-phenyl ester (+-)-metipranolol |
|
| has_RxCUI |
10824 |
|
| id |
CHEBI:6897 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H27NO4/c1-10(2)18-8-15(20)9-21-16-7-11(3)17(22-14(6)19)13(5)12(16)4/h7,10,15,18,20H,8-9H2,1-6H3 |
|
| inchikey |
BQIPXWYNLPYNHW-UHFFFAOYSA-N |
|
| is bearer of | ||
| label |
metipranolol Metipranolol |
|
| mass |
309.40060 |
|
| monoisotopicmass |
309.19401 |
|
| notation |
CHEBI:6897 |
|
| prefixIRI |
CHEBI:6897 |
|
| prefLabel |
Metipranolol |
|
| smiles |
CC(C)NCC(O)COc1cc(C)c(OC(C)=O)c(C)c1C |
|
| textual definition |
3-(Propan-2-ylamino)propane-1,2-diol in which the hydrogen of the primary hydroxy group is substituted by a 4-acetoxy-2,3,5-trimethylphenoxy group. A non-cardioselective beta-blocker, it is used to lower intra-ocular pressure in the management of open-angle glaucoma. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_47622 http://purl.obolibrary.org/obo/CHEBI_35533 |