Preferred Name |
ezogabine |
|
Synonyms |
N-(2-Amino-4-(4-fluorobenzylamino)-phenyl) carbamic acid ethyl ester Ethyl 2-amino-4-((p-fluorobenzyl)amino)carbanilate N-(2-Amino-4-(4-fluorobenzylamino)phenyl)carbamic acid ethyl ester ethyl {2-amino-4-[(4-fluorobenzyl)amino]phenyl}carbamate D-23129 Potiga retigabine |
|
Definitions |
A substituted aniline that is benzene-1,2,4-triamine bearing ethoxycarbonyl and 4-fluorobenzyl substituents at positions N-1 and N-4 respectively. An anticonvulsant used to treat seizures associated with epilepsy in adults. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_68584 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:8072099 Drug_Central:4181 Patent:US2012053238 Patent:WO2007090409 Patent:US2002183395 PMID:22991134 Patent:US2002015730 Wikipedia:Ezogabine CAS:150812-12-7 Patent:WO2011012659 Patent:US5384330 Patent:US2002111379 KEGG:D09569 Patent:US6348486 KEGG:C13826 |
|
formula |
C16H18FN3O2 |
|
has functional parent | ||
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-(2-Amino-4-(4-fluorobenzylamino)-phenyl) carbamic acid ethyl ester Ethyl 2-amino-4-((p-fluorobenzyl)amino)carbanilate N-(2-Amino-4-(4-fluorobenzylamino)phenyl)carbamic acid ethyl ester ethyl {2-amino-4-[(4-fluorobenzyl)amino]phenyl}carbamate D-23129 Potiga retigabine |
|
has_RxCUI |
1112990 |
|
id |
CHEBI:68584 |
|
in_subset | ||
inchi |
InChI=1S/C16H18FN3O2/c1-2-22-16(21)20-15-8-7-13(9-14(15)18)19-10-11-3-5-12(17)6-4-11/h3-9,19H,2,10,18H2,1H3,(H,20,21) |
|
inchikey |
PCOBBVZJEWWZFR-UHFFFAOYSA-N |
|
label |
ezogabine |
|
mass |
303.33140 |
|
monoisotopicmass |
303.13830 |
|
notation |
CHEBI:68584 |
|
prefixIRI |
CHEBI:68584 |
|
prefLabel |
ezogabine |
|
smiles |
CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)cc1N |
|
textual definition |
A substituted aniline that is benzene-1,2,4-triamine bearing ethoxycarbonyl and 4-fluorobenzyl substituents at positions N-1 and N-4 respectively. An anticonvulsant used to treat seizures associated with epilepsy in adults. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 http://purl.obolibrary.org/obo/CHEBI_37143 |