Preferred Name |
merbromin |
|
Synonyms |
disodium [2,7-dibromo-9-(2-carboxylatophenyl)-6-oxido-3-oxo-3H-xanthen-5-yl](hydroxy)mercury Mercurochrome 2,7-Dibromo-4-hydroxymercurifluoresceine disodium salt Disodium 2',7'-dibromo-4'-(hydroxymercury)fluorescein merbrominum merbromina merbromine |
|
Definitions |
An organic sodium salt that is 2,7-dibromo-4-hydroxymercurifluorescein in which the carboxy group and the phenolic hydroxy group have been deprotonated and the resulting charge is neutralised by two sodium ions. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6763 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Merbromin PMID:6177466 PMID:11141371 PMID:4433132 PMID:18061533 PMID:1692875 PMID:26177225 PMID:12974562 Reaxys:9979863 KEGG:D00861 CAS:129-16-8 PMID:4971331 PMID:88168 |
|
formula |
C20H8Br2HgNa2O6 C20H8Br2HgO6.2Na |
|
has part | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_51217 |
|
has_exact_synonym |
disodium [2,7-dibromo-9-(2-carboxylatophenyl)-6-oxido-3-oxo-3H-xanthen-5-yl](hydroxy)mercury |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Mercurochrome 2,7-Dibromo-4-hydroxymercurifluoresceine disodium salt Disodium 2',7'-dibromo-4'-(hydroxymercury)fluorescein merbrominum merbromina merbromine |
|
has_RxCUI |
6762 |
|
id |
CHEBI:6763 |
|
in_subset | ||
inchi |
InChI=1S/C20H9Br2O5.Hg.2Na.H2O/c21-13-5-11-17(7-15(13)23)27-18-8-16(24)14(22)6-12(18)19(11)9-3-1-2-4-10(9)20(25)26;;;;/h1-7,24H,(H,25,26);;;;1H2/q;3*+1;/p-3 |
|
inchikey |
SQFDQLBYJKFDDO-UHFFFAOYSA-K |
|
label |
merbromin Merbromin |
|
mass |
750.660 |
|
monoisotopicmass |
749.81895 |
|
notation |
CHEBI:6763 |
|
prefixIRI |
CHEBI:6763 |
|
prefLabel |
merbromin |
|
smiles |
C1=C(C(C=C2C1=C(C3=C(O2)C(=C(C(=C3)Br)[O-])[Hg]O)C4=CC=CC=C4C([O-])=O)=O)Br.[Na+].[Na+] |
|
textual definition |
An organic sodium salt that is 2,7-dibromo-4-hydroxymercurifluorescein in which the carboxy group and the phenolic hydroxy group have been deprotonated and the resulting charge is neutralised by two sodium ions. |
|
subClassOf |