Preferred Name |
magnesium nitrate |
|
Synonyms |
magnesium dinitrate |
|
Definitions |
The inorganic nitrate salt of magnesium. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_64736 |
|
charge |
0 |
|
database_cross_reference |
PMID:21581827 Reaxys:16055468 PMID:22295801 PMID:20638887 CAS:10377-60-3 PMID:18930247 |
|
formula |
MgN2O6 |
|
has role | ||
has_exact_synonym |
magnesium dinitrate |
|
has_obo_namespace |
chebi_ontology |
|
has_RxCUI |
1362814 |
|
id |
CHEBI:64736 |
|
in_subset | ||
inchi |
InChI=1S/Mg.2NO3/c;2*2-1(3)4/q+2;2*-1 |
|
inchikey |
YIXJRHPUWRPCBB-UHFFFAOYSA-N |
|
label |
magnesium nitrate |
|
mass |
148.31480 |
|
monoisotopicmass |
147.96068 |
|
notation |
CHEBI:64736 |
|
prefixIRI |
CHEBI:64736 |
|
prefLabel |
magnesium nitrate |
|
smiles |
[Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
|
textual definition |
The inorganic nitrate salt of magnesium. |
|
subClassOf |
Create mapping