Preferred Name |
cantharidin |
|
Synonyms |
1,2-Dimethyl-3,6-epoxyperhydrophthalic anhydride Kantharidin exo-1,2-cis-Dimethyl-3,6-epoxyhexahydrophthalic anhydride Cantharidine Cantharone (3aR,4S,7R,7aS)-3a,7a-dimethylhexahydro-4,7-epoxy-2-benzofuran-1,3-dione |
|
Definitions |
A monoterpenoid with an epoxy-bridged cyclic dicarboxylic anhydride structure secreted by many species of blister beetle, and most notably by the Spanish fly, Lytta vesicatoria. Natural toxin inhibitor of protein phosphatases 1 and 2A. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_64213 |
|
alternative term |
1,2-Dimethyl-3,6-epoxyperhydrophthalic anhydride Kantharidin exo-1,2-cis-Dimethyl-3,6-epoxyhexahydrophthalic anhydride Cantharidine Cantharone (3aR,4S,7R,7aS)-3a,7a-dimethylhexahydro-4,7-epoxy-2-benzofuran-1,3-dione |
|
bearer_of | ||
charge |
0 |
|
database_cross_reference |
Beilstein:85302 PMID:21595743 KEGG:C16778 Wikipedia:Cantharidin PMID:22001622 LINCS:LSM-42705 PMID:22402807 PMID:21668865 PMID:22351815 Reaxys:85302 PMID:21907641 PMID:22380659 CAS:56-25-7 KNApSAcK:C00010979 PMID:20594813 PMID:22233030 PMID:21930197 |
|
formula |
C10H12O4 |
|
has role | ||
has_exact_synonym |
(3aR,4S,7R,7aS)-3a,7a-dimethylhexahydro-4,7-epoxy-2-benzofuran-1,3-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,2-Dimethyl-3,6-epoxyperhydrophthalic anhydride Kantharidin exo-1,2-cis-Dimethyl-3,6-epoxyhexahydrophthalic anhydride Cantharidine Cantharone |
|
has_RxCUI |
1984 |
|
id |
CHEBI:64213 |
|
in_subset | ||
inchi |
InChI=1S/C10H12O4/c1-9-5-3-4-6(13-5)10(9,2)8(12)14-7(9)11/h5-6H,3-4H2,1-2H3/t5-,6+,9+,10- |
|
inchikey |
DHZBEENLJMYSHQ-XCVPVQRUSA-N |
|
label |
cantharidin Cantharidin |
|
mass |
196.19990 |
|
monoisotopicmass |
196.07356 |
|
notation |
CHEBI:64213 |
|
prefixIRI |
CHEBI:64213 |
|
prefLabel |
cantharidin |
|
smiles |
C[C@]12[C@@H]3CC[C@@H](O3)[C@@]1(C)C(=O)OC2=O |
|
textual definition |
A monoterpenoid with an epoxy-bridged cyclic dicarboxylic anhydride structure secreted by many species of blister beetle, and most notably by the Spanish fly, Lytta vesicatoria. Natural toxin inhibitor of protein phosphatases 1 and 2A. |
|
subClassOf |