loading...| Preferred Name |
lenalidomide |
|
| Synonyms |
3-(4-amino-1-oxo-1,3-dihydro-2H-isoindol-2-yl)piperidine-2,6-dione lenalidomide 3-(4-Amino-1-oxoisoindolin-2-yl)piperidine-2,6-dione 1-oxo-2-(2,6-dioxopiperidin-3-yl)-4-aminoisoindoline Revlimid |
|
| Definitions |
A dicarboximide that consists of 1-oxoisoindoline bearing an amino substituent at position 4 and a 2,6-dioxopiperidin-3-yl group at position 2. Inhibits the secretion of TNF-alpha. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63791 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21533608 Reaxys:8335210 PMID:22246035 PMID:22211836 Wikipedia:Lenalidomide PMID:21823830 Drug_Central:3317 PMID:22245427 KEGG:D04687 PMID:21835953 PMID:22245805 PMID:22245806 PMID:22261445 PMID:22241792 PMID:22001752 CAS:191732-72-6 PMID:22253550 PMID:22107129 LINCS:LSM-6187 PMID:22066855 PMID:22143062 DrugBank:DB00480 |
|
| formula |
C13H13N3O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| has_exact_synonym |
3-(4-amino-1-oxo-1,3-dihydro-2H-isoindol-2-yl)piperidine-2,6-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
lenalidomide 3-(4-Amino-1-oxoisoindolin-2-yl)piperidine-2,6-dione 1-oxo-2-(2,6-dioxopiperidin-3-yl)-4-aminoisoindoline Revlimid |
|
| has_RxCUI |
342369 |
|
| id |
CHEBI:63791 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H13N3O3/c14-9-3-1-2-7-8(9)6-16(13(7)19)10-4-5-11(17)15-12(10)18/h1-3,10H,4-6,14H2,(H,15,17,18) |
|
| inchikey |
GOTYRUGSSMKFNF-UHFFFAOYSA-N |
|
| label |
lenalidomide |
|
| mass |
259.26060 |
|
| monoisotopicmass |
259.09569 |
|
| notation |
CHEBI:63791 |
|
| prefixIRI |
CHEBI:63791 |
|
| prefLabel |
lenalidomide |
|
| smiles |
Nc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O |
|
| textual definition |
A dicarboximide that consists of 1-oxoisoindoline bearing an amino substituent at position 4 and a 2,6-dioxopiperidin-3-yl group at position 2. Inhibits the secretion of TNF-alpha. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33860 http://purl.obolibrary.org/obo/CHEBI_24897 |