Preferred Name |
nelarabine |
|
Synonyms |
nelzarabine Nelzarabine 2-Amino-9-beta-D-arabinofuranosyl-6-methoxy-9H-purine Arranon 9-(beta-D-arabinofuranosyl)-6-methoxy-9H-purin-2-amine |
|
Definitions |
A purine nucleoside in which O-methylguanine is attached to arabinofuranose via a beta-N(9)-glycosidic bond. Inhibits DNA synthesis and causes cell death; a prodrug of 9-beta-D-arabinofuranosylguanine (ara-G). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63612 |
|
alternative term |
nelzarabine Nelzarabine 2-Amino-9-beta-D-arabinofuranosyl-6-methoxy-9H-purine Arranon 9-(beta-D-arabinofuranosyl)-6-methoxy-9H-purin-2-amine |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
charge |
0 |
|
database_cross_reference |
PMID:21715318 PMID:21320002 KEGG:D06488 CAS:121032-29-9 PMID:21151585 PMID:20043113 KEGG:D05134 PMID:22184539 PMID:18586926 PMID:21353591 PMID:20528871 PMID:21737993 PMID:21190039 Drug_Central:1892 PMID:20616909 DrugBank:DB01280 PMID:19825456 PMID:21730354 Reaxys:13568768 PMID:20796200 PMID:63612 |
|
formula |
C11H15N5O5 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
has_exact_synonym |
9-(beta-D-arabinofuranosyl)-6-methoxy-9H-purin-2-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
nelzarabine Nelzarabine 2-Amino-9-beta-D-arabinofuranosyl-6-methoxy-9H-purine Arranon |
|
has_RxCUI |
274771 |
|
id |
CHEBI:63612 |
|
in_subset | ||
inchi |
InChI=1S/C11H15N5O5/c1-20-9-5-8(14-11(12)15-9)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15)/t4-,6-,7+,10-/m1/s1 |
|
inchikey |
IXOXBSCIXZEQEQ-UHTZMRCNSA-N |
|
label |
nelarabine |
|
mass |
297.26730 |
|
monoisotopicmass |
297.10732 |
|
notation |
CHEBI:63612 |
|
prefixIRI |
CHEBI:63612 |
|
prefLabel |
nelarabine |
|
smiles |
COc1nc(N)nc2n(cnc12)[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
|
textual definition |
A purine nucleoside in which O-methylguanine is attached to arabinofuranose via a beta-N(9)-glycosidic bond. Inhibits DNA synthesis and causes cell death; a prodrug of 9-beta-D-arabinofuranosylguanine (ara-G). |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26394 |