Preferred Name |
Lamivudine |
|
Synonyms |
4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2(1H)-one Lamivudine 2',3'-Dideoxy-3'-thiacytidine (-)-1-((2R,5S)-2-(Hydroxymethyl)-1,3-oxathiolan-5-yl)cytosine (-)-2'-Deoxy-3'-thiacytidine 3'-Thia-2',3'-dideoxycytidine beta-L-2',3'-Dideoxy-3'-thiacytidine beta-L-3'-Thia-2',3'-dideoxycytidine 3TC Epivir lamivudine |
|
Definitions |
A monothioacetal that consists of cytosine having a (2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl moiety attached at position 1. An inhibitor of HIV-1 reverse transcriptase, it is used as an antiviral in the treatment of AIDS and hepatitis B. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63577 |
|
charge |
0 |
|
database_cross_reference |
PMID:22170540 PMID:19783232 PMID:22085635 LINCS:LSM-5215 PMID:22001270 Wikipedia:Lamivudine PMID:25017682 PMID:22231575 PMID:21851334 PMID:21721935 Drug_Central:1539 CAS:134678-17-4 PMID:22098177 Patent:WO9117159 Reaxys:5480511 PMID:22097898 PMID:22028068 PMID:22222724 PMID:21465499 KEGG:C07065 PMID:28166217 PMID:12135009 PMID:22226087 KEGG:D00353 PMID:22211086 PDBeChem:3TC PMID:22078148 PMID:29438107 PMID:22233654 DrugBank:DB00709 |
|
formula |
C8H11N3O3S |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_53756 http://purl.obolibrary.org/obo/CHEBI_50904 http://purl.obolibrary.org/obo/CHEBI_59897 http://purl.obolibrary.org/obo/CHEBI_36044 |
|
has_alternative_id |
CHEBI:6366 |
|
has_exact_synonym |
4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2(1H)-one Lamivudine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2',3'-Dideoxy-3'-thiacytidine (-)-1-((2R,5S)-2-(Hydroxymethyl)-1,3-oxathiolan-5-yl)cytosine (-)-2'-Deoxy-3'-thiacytidine 3'-Thia-2',3'-dideoxycytidine beta-L-2',3'-Dideoxy-3'-thiacytidine beta-L-3'-Thia-2',3'-dideoxycytidine 3TC Epivir lamivudine |
|
has_RxCUI |
68244 |
|
id |
CHEBI:63577 |
|
in_subset | ||
inchi |
InChI=1S/C8H11N3O3S/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7+/m0/s1 |
|
inchikey |
JTEGQNOMFQHVDC-NKWVEPMBSA-N |
|
label |
Lamivudine lamivudine |
|
mass |
229.25600 |
|
monoisotopicmass |
229.05211 |
|
notation |
CHEBI:63577 |
|
prefixIRI |
CHEBI:63577 |
|
prefLabel |
Lamivudine |
|
smiles |
Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1 |
|
textual definition |
A monothioacetal that consists of cytosine having a (2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl moiety attached at position 1. An inhibitor of HIV-1 reverse transcriptase, it is used as an antiviral in the treatment of AIDS and hepatitis B. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_59793 http://purl.obolibrary.org/obo/CHEBI_38104 |