loading...| Preferred Name |
thiosalicylic acid |
|
| Synonyms |
2-sulfanylbenzoic acid Thiophenol-2-carboxylic acid 2-Sulfanylbenzoic acid o-Thiosalicylic acid o-Sulfhydrylbenzoic acid o-Mercaptobenzoic acid 2-Mercaptobenzoic acid o-Mercaptobenzoesaeure o-Benzoic acid thiol 2-Thiosalicylic acid o-Carboxythiophenol 2-Carboxythiophenol |
|
| Definitions |
A sulfanylbenzoic acid that is the 2-sulfanyl derivative of benzoic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59124 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:DE205450 Drug_Central:4856 Reaxys:508507 PMID:1650428 PMID:23934301 Gmelin:3838 Beilstein:508507 KEGG:D08586 PDBeChem:JKE PMID:24728505 Patent:DE189200 CAS:147-93-3 Wikipedia:Thiosalicylic_acid PMID:24369647 |
|
| formula |
C7H6O2S |
|
| has role | ||
| has_exact_synonym |
2-sulfanylbenzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Thiophenol-2-carboxylic acid 2-Sulfanylbenzoic acid o-Thiosalicylic acid o-Sulfhydrylbenzoic acid o-Mercaptobenzoic acid 2-Mercaptobenzoic acid o-Mercaptobenzoesaeure o-Benzoic acid thiol 2-Thiosalicylic acid o-Carboxythiophenol 2-Carboxythiophenol |
|
| has_RxCUI |
322165 |
|
| id |
CHEBI:59124 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H6O2S/c8-7(9)5-3-1-2-4-6(5)10/h1-4,10H,(H,8,9) |
|
| inchikey |
NBOMNTLFRHMDEZ-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
thiosalicylic acid |
|
| mass |
154.18600 |
|
| monoisotopicmass |
154.00885 |
|
| notation |
CHEBI:59124 |
|
| prefixIRI |
CHEBI:59124 |
|
| prefLabel |
thiosalicylic acid |
|
| smiles |
OC(=O)c1ccccc1S |
|
| textual definition |
A sulfanylbenzoic acid that is the 2-sulfanyl derivative of benzoic acid. |
|
| subClassOf |