Jump to:
loading...| Preferred Name |
butane-1,2,3,4-tetrol |
|
| Synonyms |
butane-1,2,3,4-tetrol 1,2,3,4-tetrahydroxybutane Erythrite Erythrol Phycite Phycitol |
|
| Definitions |
A tetritol that is butane substituted by hydroxy groups at positions 1, 2, 3 and 4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_48299 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D08915 Beilstein:1735878 KNApSAcK:C00001161 KEGG:C00503 Reaxys:1735878 CAS:149-32-6 CAS:7541-59-5 |
|
| formula |
C4H10O4 |
|
| has_exact_synonym |
butane-1,2,3,4-tetrol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,2,3,4-tetrahydroxybutane Erythrite Erythrol Phycite Phycitol |
|
| id |
CHEBI:48299 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2 |
|
| inchikey |
UNXHWFMMPAWVPI-UHFFFAOYSA-N |
|
| label |
butane-1,2,3,4-tetrol |
|
| mass |
122.11980 |
|
| monoisotopicmass |
122.05791 |
|
| notation |
CHEBI:48299 |
|
| prefLabel |
butane-1,2,3,4-tetrol |
|
| smiles |
OCC(O)C(O)CO |
|
| textual definition |
A tetritol that is butane substituted by hydroxy groups at positions 1, 2, 3 and 4. |
|
| subClassOf |
Create mapping