Preferred Name |
Bezafibrate |
|
Synonyms |
2-{4-[2-(4-chlorobenzamido)ethyl]phenoxy}-2-methylpropanoic acid Bezatol SR (TN) 2-(p-(2-(p-Chlorobenzamido)ethyl)phenoxy)-2-methylpropionic acid bezafibratum bezafibrato bezafibrate Befizal Bezalip Cedur |
|
Definitions |
A monocarboxylic acid amide obtained by the formal condensation of the carboxy group of 4-chlorobenzoic acid with the amino group of 2-[4-(2-aminoethyl)phenoxy]-2-methylpropanoic acid. Benafibrate is used for the treatment of hyperlipidaemia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_47612 |
|
charge |
0 |
|
database_cross_reference |
Patent:DE2149070 Wikipedia:Bezafibrate PMID:32509533 Drug_Central:362 Chemspider:35728 PMID:17379010 HMDB:HMDB0015465 Reaxys:4267656 PMID:32798077 CAS:41859-67-0 PMID:33205029 PMID:19131462 PDBeChem:PEM PMID:32976735 PMID:12782154 PMID:33549744 PMID:28931607 DrugBank:DB01393 PMID:18787029 KEGG:D01366 LINCS:LSM-3015 Patent:US3781328 PMID:32107855 PMID:12122004 PMID:32721217 PMID:34447954 PMID:23603800 |
|
formula |
C19H20ClNO4 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35679 http://purl.obolibrary.org/obo/CHEBI_176497 |
|
has_alternative_id |
CHEBI:31284 CHEBI:47611 |
|
has_exact_synonym |
2-{4-[2-(4-chlorobenzamido)ethyl]phenoxy}-2-methylpropanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Bezatol SR (TN) 2-(p-(2-(p-Chlorobenzamido)ethyl)phenoxy)-2-methylpropionic acid bezafibratum bezafibrato bezafibrate Befizal Bezalip Cedur |
|
has_RxCUI |
1525 |
|
id |
CHEBI:47612 |
|
in_subset | ||
inchi |
InChI=1S/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24) |
|
inchikey |
IIBYAHWJQTYFKB-UHFFFAOYSA-N |
|
label |
bezafibrate Bezafibrate |
|
mass |
361.820 |
|
monoisotopicmass |
361.10809 |
|
notation |
CHEBI:47612 |
|
prefixIRI |
CHEBI:47612 |
|
prefLabel |
Bezafibrate |
|
smiles |
CC(C)(OC1=CC=C(CCNC(=O)C2=CC=C(Cl)C=C2)C=C1)C(O)=O |
|
textual definition |
A monocarboxylic acid amide obtained by the formal condensation of the carboxy group of 4-chlorobenzoic acid with the amino group of 2-[4-(2-aminoethyl)phenoxy]-2-methylpropanoic acid. Benafibrate is used for the treatment of hyperlipidaemia. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_83403 |