Preferred Name |
desferrioxamine B |
|
Synonyms |
N'-{5-[acetyl(hydroxy)amino]pentyl}-N-(5-{4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanamido}pentyl)-N-hydroxybutanediamide Desferrioxamine desferrioxamine-B Deferoxamin deferoxaminum N(4)-{5-[acetyl(hydroxy)amino]pentyl}-N(1)-(5-{4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanamido}pentyl)-N(1)-hydroxybutanediamide Deferrioxamine deferrioxamine B deferoxamina deferoxamine DFO DFOB |
|
Definitions |
An acyclic desferrioxamine that is butanedioic acid in which one of the carboxy groups undergoes formal condensation with the primary amino group of N-(5-aminopentyl)-N-hydroxyacetamide and the second carboxy group undergoes formal condensation with the hydroxyamino group of N(1)-(5-aminopentyl)-N(1)-hydroxy-N(4)-[5-(hydroxyamino)pentyl]butanediamide. It is a siderophore native to Streptomyces pilosus biosynthesised by the DesABCD enzyme cluster as a high affinity Fe(III) chelator. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4356 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D03670 PMID:28318697 PMID:28285915 PMID:11239825 PMID:30701380 Drug_Central:792 KEGG:C06940 PMID:18536609 Wikipedia:Deferoxamine Chemspider:2867 Beilstein:2514118 PMID:31846315 PMID:31035197 PMID:32856363 PMID:32734456 PMID:32039778 PMID:31229836 PMID:29182270 PMID:33784308 LIPID_MAPS_instance:LMFA08020169 DrugBank:DB00746 LINCS:LSM-6541 CAS:70-51-9 PMID:28156129 Patent:BE609053 HMDB:HMDB0014884 PMID:32572744 PMID:28455567 |
|
formula |
C25H48N6O8 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_38157 http://purl.obolibrary.org/obo/CHEBI_173084 |
|
has_exact_synonym |
N'-{5-[acetyl(hydroxy)amino]pentyl}-N-(5-{4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanamido}pentyl)-N-hydroxybutanediamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Desferrioxamine desferrioxamine-B Deferoxamin deferoxaminum N(4)-{5-[acetyl(hydroxy)amino]pentyl}-N(1)-(5-{4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanamido}pentyl)-N(1)-hydroxybutanediamide Deferrioxamine deferrioxamine B deferoxamina deferoxamine DFO DFOB |
|
has_RxCUI |
3131 |
|
id |
CHEBI:4356 |
|
in_subset | ||
inchi |
InChI=1S/C25H48N6O8/c1-21(32)29(37)18-9-3-6-16-27-22(33)12-14-25(36)31(39)20-10-4-7-17-28-23(34)11-13-24(35)30(38)19-8-2-5-15-26/h37-39H,2-20,26H2,1H3,(H,27,33)(H,28,34) |
|
inchikey |
UBQYURCVBFRUQT-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
label |
desferrioxamine B Deferoxamine |
|
mass |
560.693 |
|
monoisotopicmass |
560.35336 |
|
notation |
CHEBI:4356 |
|
prefixIRI |
CHEBI:4356 |
|
prefLabel |
desferrioxamine B |
|
smiles |
CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN |
|
textual definition |
An acyclic desferrioxamine that is butanedioic acid in which one of the carboxy groups undergoes formal condensation with the primary amino group of N-(5-aminopentyl)-N-hydroxyacetamide and the second carboxy group undergoes formal condensation with the hydroxyamino group of N(1)-(5-aminopentyl)-N(1)-hydroxy-N(4)-[5-(hydroxyamino)pentyl]butanediamide. It is a siderophore native to Streptomyces pilosus biosynthesised by the DesABCD enzyme cluster as a high affinity Fe(III) chelator. |
|
subClassOf |