Preferred Name |
nitenpyram |
|
Synonyms |
N-[(6-chloropyridin-3-yl)methyl]-N-ethyl-N'-methyl-2-nitroethene-1,1-diamine |
|
Definitions |
A C-nitro compound consisting of 2-nitroethene-1,1-diamine where one of the nitrogens bears ethyl and (6-chloro-3-pyridinyl)methyl while the other nitrogen carries a methyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_39171 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:8553513 PMID:21714058 Beilstein:8553513 PMID:10789501 |
|
formula |
C11H15ClN4O2 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
N-[(6-chloropyridin-3-yl)methyl]-N-ethyl-N'-methyl-2-nitroethene-1,1-diamine |
|
has_obo_namespace |
chebi_ontology |
|
has_RxCUI |
341379 |
|
id |
CHEBI:39171 |
|
in_subset | ||
inchi |
InChI=1S/C11H15ClN4O2/c1-3-15(11(13-2)8-16(17)18)7-9-4-5-10(12)14-6-9/h4-6,8,13H,3,7H2,1-2H3 |
|
inchikey |
CFRPSFYHXJZSBI-UHFFFAOYSA-N |
|
label |
nitenpyram |
|
mass |
270.71500 |
|
monoisotopicmass |
270.08835 |
|
notation |
CHEBI:39171 |
|
prefixIRI |
CHEBI:39171 |
|
prefLabel |
nitenpyram |
|
smiles |
[H]C(=C(NC)N(CC)Cc1ccc(Cl)nc1)[N+]([O-])=O |
|
textual definition |
A C-nitro compound consisting of 2-nitroethene-1,1-diamine where one of the nitrogens bears ethyl and (6-chloro-3-pyridinyl)methyl while the other nitrogen carries a methyl group. |
|
subClassOf |