Preferred Name |
anthralin |
|
Synonyms |
1,8-dihydroxyanthracen-9(10H)-one Anthralin 1,8-dihydroxy-9(10H)-anthracenone 1,8-dihydroxyanthrone 1,8-dihydroxy-9-anthrone dithranol |
|
Definitions |
An anthracene compound derived by the substitution of -OH groups for hydrogen at C-1 and C-8, and with an oxo group at C-9. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_37510 |
|
charge |
0 |
|
database_cross_reference |
PMID:23488784 Reaxys:2054360 KEGG:D00233 CAS:1143-38-0 PMID:22370944 KEGG:C06831 PMID:23079823 PMID:22931516 LINCS:LSM-6530 PMID:23088318 Wikipedia:Dithranol PMID:23594093 PMID:1640019 PMID:22335232 Drug_Central:226 Beilstein:2054360 |
|
formula |
C14H10O3 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
1,8-dihydroxyanthracen-9(10H)-one Anthralin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,8-dihydroxy-9(10H)-anthracenone 1,8-dihydroxyanthrone 1,8-dihydroxy-9-anthrone dithranol |
|
has_RxCUI |
873 |
|
id |
CHEBI:37510 |
|
in_subset | ||
inchi |
InChI=1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-6,15-16H,7H2 |
|
inchikey |
NUZWLKWWNNJHPT-UHFFFAOYSA-N |
|
is tautomer of | ||
label |
Anthralin anthralin |
|
mass |
226.22740 |
|
monoisotopicmass |
226.06299 |
|
notation |
CHEBI:37510 |
|
prefixIRI |
CHEBI:37510 |
|
prefLabel |
anthralin |
|
smiles |
Oc1cccc2Cc3cccc(O)c3C(=O)c12 |
|
textual definition |
An anthracene compound derived by the substitution of -OH groups for hydrogen at C-1 and C-8, and with an oxo group at C-9. |
|
subClassOf |