loading...| Preferred Name |
phenyl salicylate |
|
| Synonyms |
Phenyl-2-hydroxybenzoate 2-Hydroxy-benzoic acid phenyl ester 2-Phenoxycarbonylphenol Phenol salicylate salicylic acid phenyl ester salol phenyl 2-hydroxybenzoate |
|
| Definitions |
A benzoate ester that is the phenyl ester of salicylic acid. Also known as salol, it can be formed by heating salicylic acid with phenol and is used in the manufacture of some polymers, lacquers, adhesives, waxes and polishes. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34918 |
|
| alternative term |
Phenyl-2-hydroxybenzoate 2-Hydroxy-benzoic acid phenyl ester 2-Phenoxycarbonylphenol Phenol salicylate salicylic acid phenyl ester salol phenyl 2-hydroxybenzoate |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0032018 Gmelin:219822 PMID:1650428 PMID:7326927 PMID:18031889 Drug_Central:3462 PMID:24004914 CAS:118-55-8 Wikipedia:Phenyl_salicylate Beilstein:393969 KEGG:C14163 Reaxys:393969 |
|
| formula |
C13H10O3 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
phenyl 2-hydroxybenzoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Phenyl-2-hydroxybenzoate 2-Hydroxy-benzoic acid phenyl ester 2-Phenoxycarbonylphenol Phenol salicylate salicylic acid phenyl ester salol |
|
| has_RxCUI |
36122 |
|
| id |
CHEBI:34918 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H10O3/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h1-9,14H |
|
| inchikey |
ZQBAKBUEJOMQEX-UHFFFAOYSA-N |
|
| label |
phenyl salicylate |
|
| mass |
214.21670 |
|
| monoisotopicmass |
214.06299 |
|
| notation |
CHEBI:34918 |
|
| prefixIRI |
CHEBI:34918 |
|
| prefLabel |
phenyl salicylate |
|
| smiles |
Oc1ccccc1C(=O)Oc1ccccc1 |
|
| textual definition |
A benzoate ester that is the phenyl ester of salicylic acid. Also known as salol, it can be formed by heating salicylic acid with phenol and is used in the manufacture of some polymers, lacquers, adhesives, waxes and polishes. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26596 |