loading...| Preferred Name |
Ethisterone |
|
| Synonyms |
anhydroxyprogesterone Progestoral anhydrohydroxyprogesterone 17alpha-ethinyltestosterone 17-beta-hydroxy-17-alpha-ethynyl-4-androsten-3-one 17-ethynyl-17beta-hydroxyandrost-4-en-3-one aethisteronum 17-hydroxy-17alpha-pregn-4-en-20-yn-3-one 17alpha-ethynyl-17beta-hydroxyandrost-4-en-3-one ethynyltestosterone aethisteron Syngestrotabs 17alpha-ethynyltestosterone ethisteronum ethisterone Lutocylol Nugestoral Ora-Lutin Pranone Prodroxan Produxan Progestab Trosinone etisterona (17alpha)-17-hydroxypregn-4-en-20-yn-3-one |
|
| Definitions |
A 17beta-hydroxy steroid that is testosterone in which the 17beta hydrogen is replaced by an ethynyl group. Ethisterone was the first orally active progestin and is a metabolite of danazol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34749 |
|
| alternative term |
anhydroxyprogesterone Progestoral anhydrohydroxyprogesterone 17alpha-ethinyltestosterone 17-beta-hydroxy-17-alpha-ethynyl-4-androsten-3-one 17-ethynyl-17beta-hydroxyandrost-4-en-3-one aethisteronum 17-hydroxy-17alpha-pregn-4-en-20-yn-3-one 17alpha-ethynyl-17beta-hydroxyandrost-4-en-3-one ethynyltestosterone aethisteron Syngestrotabs 17alpha-ethynyltestosterone ethisteronum ethisterone Lutocylol Nugestoral Ora-Lutin Pranone Prodroxan Produxan Progestab Trosinone etisterona (17alpha)-17-hydroxypregn-4-en-20-yn-3-one |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Ethisterone Drug_Central:1084 CAS:434-03-7 KEGG:C14487 Reaxys:1889895 HMDB:HMDB0060580 PMID:374128 PMID:8327560 PMID:13494335 |
|
| formula |
C21H28O2 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
(17alpha)-17-hydroxypregn-4-en-20-yn-3-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
anhydroxyprogesterone Progestoral anhydrohydroxyprogesterone 17alpha-ethinyltestosterone 17-beta-hydroxy-17-alpha-ethynyl-4-androsten-3-one 17-ethynyl-17beta-hydroxyandrost-4-en-3-one aethisteronum 17-hydroxy-17alpha-pregn-4-en-20-yn-3-one 17alpha-ethynyl-17beta-hydroxyandrost-4-en-3-one ethynyltestosterone aethisteron Syngestrotabs 17alpha-ethynyltestosterone ethisteronum ethisterone Lutocylol Nugestoral Ora-Lutin Pranone Prodroxan Produxan Progestab Trosinone etisterona |
|
| has_RxCUI |
4129 |
|
| id |
CHEBI:34749 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H28O2/c1-4-21(23)12-9-18-16-6-5-14-13-15(22)7-10-19(14,2)17(16)8-11-20(18,21)3/h1,13,16-18,23H,5-12H2,2-3H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
|
| inchikey |
CHNXZKVNWQUJIB-CEGNMAFCSA-N |
|
| label |
ethisterone Ethisterone |
|
| mass |
312.44580 |
|
| monoisotopicmass |
312.20893 |
|
| notation |
CHEBI:34749 |
|
| prefixIRI |
CHEBI:34749 |
|
| prefLabel |
Ethisterone |
|
| smiles |
C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@@]2(O)C#C |
|
| textual definition |
A 17beta-hydroxy steroid that is testosterone in which the 17beta hydrogen is replaced by an ethynyl group. Ethisterone was the first orally active progestin and is a metabolite of danazol. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_73477 http://purl.obolibrary.org/obo/CHEBI_35343 |