loading...| Preferred Name |
methyl salicylate |
|
| Synonyms |
methyl salicylate Natural wintergreen oil 2-(Methoxycarbonyl)phenol 2-Carbomethoxyphenol Methyl 2-hydroxybenzoate Spicewood Oil Gaultheria oil Teaberry oil Methyl o-hydroxybenzoate Oil of wintergreen 2-Hydroxybenzoic acid methyl ester Sweet birch oil Betula oil |
|
| Definitions |
A benzoate ester that is the methyl ester of salicylic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31832 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21327960 PMID:21249432 CAS:119-36-8 PMID:21936953 KEGG:D01087 PMID:21790190 PMID:21609308 Wikipedia:Methyl_salicylate Drug_Central:4245 KNApSAcK:C00030767 PMID:21404848 KEGG:C12305 PMID:21287406 Reaxys:971516 |
|
| formula |
C8H8O3 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35617 |
|
| has_exact_synonym |
methyl salicylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Natural wintergreen oil 2-(Methoxycarbonyl)phenol 2-Carbomethoxyphenol Methyl 2-hydroxybenzoate Spicewood Oil Gaultheria oil Teaberry oil Methyl o-hydroxybenzoate Oil of wintergreen 2-Hydroxybenzoic acid methyl ester Sweet birch oil Betula oil |
|
| has_RxCUI |
29787 |
|
| id |
CHEBI:31832 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H8O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5,9H,1H3 |
|
| inchikey |
OSWPMRLSEDHDFF-UHFFFAOYSA-N |
|
| label |
methyl salicylate |
|
| mass |
152.14730 |
|
| monoisotopicmass |
152.04734 |
|
| notation |
CHEBI:31832 |
|
| prefixIRI |
CHEBI:31832 |
|
| prefLabel |
methyl salicylate |
|
| smiles |
COC(=O)c1ccccc1O |
|
| textual definition |
A benzoate ester that is the methyl ester of salicylic acid. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26596 |