Preferred Name |
Brompheniramine |
|
Synonyms |
3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine Brompheniramine 3-(p-bromophenyl)-3-(2-pyridyl)-N,N-dimethylpropylamine 1-(p-bromophenyl)-1-(2-pyridyl)-3-dimethylaminopropane 3-(4-bromophenyl)-N,N-dimethyl-3-(2-pyridinyl)-1-propanamine 2-(p-bromo-alpha-(2-dimethylaminoethyl)benzyl)pyridine [3-(4-Bromo-phenyl)-3-pyridin-2-yl-propyl]-dimethyl-amine bromfeniramina brompheniraminum brompheniramine |
|
Definitions |
Pheniramine in which the hydrogen at position 4 of the phenyl substituent is substituted by bromine. A histamine H1 receptor antagonist, brompheniramine is used (commonly as its maleate salt) for the symptomatic relief of allergic conditions, including rhinitis and conjunctivitis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3183 |
|
charge |
0 |
|
database_cross_reference |
PMID:9526560 KEGG:D07543 KEGG:C06857 PMID:6458703 Patent:US2567245 PMID:2579237 Patent:US2676964 PMID:2570152 Wikipedia:Brompheniramine Drug_Central:408 CAS:86-22-6 DrugBank:DB00835 Beilstein:217066 LINCS:LSM-1736 |
|
formula |
C16H19BrN2 |
|
has role | ||
has_alternative_id |
CHEBI:154051 |
|
has_exact_synonym |
3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine Brompheniramine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3-(p-bromophenyl)-3-(2-pyridyl)-N,N-dimethylpropylamine 1-(p-bromophenyl)-1-(2-pyridyl)-3-dimethylaminopropane 3-(4-bromophenyl)-N,N-dimethyl-3-(2-pyridinyl)-1-propanamine 2-(p-bromo-alpha-(2-dimethylaminoethyl)benzyl)pyridine [3-(4-Bromo-phenyl)-3-pyridin-2-yl-propyl]-dimethyl-amine bromfeniramina brompheniraminum brompheniramine |
|
has_RxCUI |
1767 |
|
id |
CHEBI:3183 |
|
in_subset | ||
inchi |
InChI=1S/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
|
inchikey |
ZDIGNSYAACHWNL-UHFFFAOYSA-N |
|
label |
brompheniramine Brompheniramine |
|
mass |
319.23900 |
|
monoisotopicmass |
318.07316 |
|
notation |
CHEBI:3183 |
|
prefixIRI |
CHEBI:3183 |
|
prefLabel |
Brompheniramine |
|
smiles |
CN(C)CCC(c1ccc(Br)cc1)c1ccccn1 |
|
textual definition |
Pheniramine in which the hydrogen at position 4 of the phenyl substituent is substituted by bromine. A histamine H1 receptor antagonist, brompheniramine is used (commonly as its maleate salt) for the symptomatic relief of allergic conditions, including rhinitis and conjunctivitis. |
|
subClassOf |