Preferred Name |
bentiromide |
|
Synonyms |
4-[(N-benzoyl-L-tyrosyl)amino]benzoic acid (S)-p-(alpha-benzamido-p-hydroxyhydrocinnamamido)benzoic acid benzoyltyrosyl-p-aminobenzoic acid N-benzoyl-L-tyrosyl-p-aminobenzoate 4-(N-benzoyl-L-tyrosylamino)benzoic acid bentiromidum bentiromido bentiromide N-benzoyl-L-tyrosyl-p-aminobenzoic acid (S)-4-((2-(benzoylamino)-3-(4-hydroxyphenyl)-1-oxopropyl)amino)benzoic acid BT-PABA BTPABA PFD PFT |
|
Definitions |
The dipeptide obtained by condensation of N-benzoyl-L-tyrosine with 4-aminobenzoic acid. Used as a noninvasive screening test for exocrine pancreatic insufficiency and to monitor the adequacy of supplemental pancreatic therapy, it is given by mouth: the amount of 4-aminobenzoic acid and its metabolites excreted in the urine is taken as a measure of the chymotrypsin-secreting activity of the pancreas. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31263 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:2910938 DrugBank:DB00522 Wikipedia:Bentiromide CAS:37106-97-1 KEGG:D01346 Patent:US3801562 Drug_Central:316 Patent:DE2156835 |
|
formula |
C23H20N2O5 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_33893 |
|
has_exact_synonym |
4-[(N-benzoyl-L-tyrosyl)amino]benzoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(S)-p-(alpha-benzamido-p-hydroxyhydrocinnamamido)benzoic acid benzoyltyrosyl-p-aminobenzoic acid N-benzoyl-L-tyrosyl-p-aminobenzoate 4-(N-benzoyl-L-tyrosylamino)benzoic acid bentiromidum bentiromido bentiromide N-benzoyl-L-tyrosyl-p-aminobenzoic acid (S)-4-((2-(benzoylamino)-3-(4-hydroxyphenyl)-1-oxopropyl)amino)benzoic acid BT-PABA BTPABA PFD PFT |
|
has_RxCUI |
18896 |
|
id |
CHEBI:31263 |
|
in_subset | ||
inchi |
InChI=1S/C23H20N2O5/c26-19-12-6-15(7-13-19)14-20(25-21(27)16-4-2-1-3-5-16)22(28)24-18-10-8-17(9-11-18)23(29)30/h1-13,20,26H,14H2,(H,24,28)(H,25,27)(H,29,30)/t20-/m0/s1 |
|
inchikey |
SPPTWHFVYKCNNK-FQEVSTJZSA-N |
|
label |
bentiromide |
|
mass |
404.41530 |
|
monoisotopicmass |
404.13722 |
|
notation |
CHEBI:31263 |
|
prefixIRI |
CHEBI:31263 |
|
prefLabel |
bentiromide |
|
smiles |
OC(=O)c1ccc(NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)c2ccccc2)cc1 |
|
textual definition |
The dipeptide obtained by condensation of N-benzoyl-L-tyrosine with 4-aminobenzoic acid. Used as a noninvasive screening test for exocrine pancreatic insufficiency and to monitor the adequacy of supplemental pancreatic therapy, it is given by mouth: the amount of 4-aminobenzoic acid and its metabolites excreted in the urine is taken as a measure of the chymotrypsin-secreting activity of the pancreas. |
|
subClassOf |