loading...| Preferred Name |
Alfacalcidol |
|
| Synonyms |
1alpha-hydroxyvitamin D3 alfacalcidol (5Z,7E)-9,10-seco-5,7,10(19)-cholestatrien-1alpha,3beta-diol alfacalcidolum 1alpha-hydroxy-vitamin D3 1alpha-hydroxycholecalciferol 9,10-secocholesta-5,7,10(19)-triene-1alpha,3beta-diol Alsiodol (1S,3R,5Z,7E)-9,10-secocholesta-5,7,10-triene-1,3-diol |
|
| Definitions |
A member of the class of D3 vitamins that is calciol in which the hydrogen at the 1alpha position is replaced by a hydroxy group. It is an active metabolite of cholecalciferol, which performs important functions in regulation of the calcium balance and the bone metabolism. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31186 |
|
| alternative term |
1alpha-hydroxyvitamin D3 alfacalcidol (5Z,7E)-9,10-seco-5,7,10(19)-cholestatrien-1alpha,3beta-diol alfacalcidolum 1alpha-hydroxy-vitamin D3 1alpha-hydroxycholecalciferol 9,10-secocholesta-5,7,10(19)-triene-1alpha,3beta-diol Alsiodol (1S,3R,5Z,7E)-9,10-secocholesta-5,7,10-triene-1,3-diol |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
PMID:24414552 HMDB:HMDB0015504 PMID:20827552 PMID:17438884 PMID:22527138 Reaxys:2064794 KEGG:D01518 PMID:22607568 PMID:24119718 PMID:17668216 CAS:41294-56-8 Drug_Central:130 DrugBank:DB01436 |
|
| formula |
C27H44O2 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
alfacalcidol (1S,3R,5Z,7E)-9,10-secocholesta-5,7,10-triene-1,3-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1alpha-hydroxyvitamin D3 alfacalcidol (5Z,7E)-9,10-seco-5,7,10(19)-cholestatrien-1alpha,3beta-diol alfacalcidolum 1alpha-hydroxy-vitamin D3 1alpha-hydroxycholecalciferol 9,10-secocholesta-5,7,10(19)-triene-1alpha,3beta-diol Alsiodol |
|
| has_RxCUI |
12062 |
|
| id |
CHEBI:31186 |
|
| in_subset | ||
| inchi |
InChI=1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1 |
|
| inchikey |
OFHCOWSQAMBJIW-AVJTYSNKSA-N |
|
| label |
alfacalcidol Alfacalcidol |
|
| mass |
400.63710 |
|
| monoisotopicmass |
400.33413 |
|
| notation |
CHEBI:31186 |
|
| prefixIRI |
CHEBI:31186 |
|
| prefLabel |
Alfacalcidol |
|
| smiles |
CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CCC\C2=C/C=C1/C[C@@H](O)C[C@H](O)C1=C |
|
| textual definition |
A member of the class of D3 vitamins that is calciol in which the hydrogen at the 1alpha position is replaced by a hydroxy group. It is an active metabolite of cholecalciferol, which performs important functions in regulation of the calcium balance and the bone metabolism. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36818 http://purl.obolibrary.org/obo/CHEBI_73558 |