loading...| Preferred Name |
tetradecanoate |
|
| Synonyms |
Tetradecanoate tetradecanoate n-tetradecan-1-oate n-tetradecoate tetradecoate 1-tetradecanecarboxylate CH3-[CH2]12-COO(-) myristate |
|
| Definitions |
A long-chain fatty acid anion that is the conjugate base of myristic acid; major species at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30807 |
|
| charge |
-1 |
|
| database_cross_reference |
Gmelin:335122 Beilstein:3589340 Reaxys:3589340 KEGG:C06424 |
|
| formula |
C14H27O2 |
|
| has role | ||
| has_alternative_id |
CHEBI:35292 |
|
| has_exact_synonym |
Tetradecanoate tetradecanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
n-tetradecan-1-oate n-tetradecoate tetradecoate 1-tetradecanecarboxylate CH3-[CH2]12-COO(-) myristate |
|
| id |
CHEBI:30807 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/p-1 |
|
| inchikey |
TUNFSRHWOTWDNC-UHFFFAOYSA-M |
|
| is conjugate base of | ||
| label |
tetradecanoate |
|
| mass |
227.364 |
|
| monoisotopicmass |
227.20165 |
|
| notation |
CHEBI:30807 |
|
| prefLabel |
tetradecanoate |
|
| smiles |
C(CCCCCCCC)CCCCC([O-])=O |
|
| textual definition |
A long-chain fatty acid anion that is the conjugate base of myristic acid; major species at pH 7.3. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_78121 http://purl.obolibrary.org/obo/CHEBI_58954 http://purl.obolibrary.org/obo/CHEBI_76928 http://purl.obolibrary.org/obo/CHEBI_76619 |