loading...| Preferred Name |
isopentane |
|
| Synonyms |
1,1,2-trimethylethane isoamylhydride 1,1-dimethylpropane iso-pentane (CH3)2CH-CH2-CH3 dimethylethylmethane R-601a iso-C5H12 2-methylbutane isopentane |
|
| Definitions |
An alkane that is butane substituted by a methyl group at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30362 |
|
| alternative term |
1,1,2-trimethylethane isoamylhydride 1,1-dimethylpropane iso-pentane (CH3)2CH-CH2-CH3 dimethylethylmethane R-601a iso-C5H12 2-methylbutane isopentane |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
PMID:24833189 Reaxys:1730723 PMID:21481069 Wikipedia:Isopentane PMID:23904008 Gmelin:49318 CAS:78-78-4 PMID:24932627 Beilstein:1730723 |
|
| formula |
C5H12 |
|
| has role | ||
| has_exact_synonym |
2-methylbutane isopentane |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,1,2-trimethylethane isoamylhydride 1,1-dimethylpropane iso-pentane (CH3)2CH-CH2-CH3 dimethylethylmethane R-601a iso-C5H12 |
|
| has_RxCUI |
1368703 |
|
| id |
CHEBI:30362 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 |
|
| inchikey |
QWTDNUCVQCZILF-UHFFFAOYSA-N |
|
| label |
isopentane |
|
| mass |
72.14878 |
|
| monoisotopicmass |
72.09390 |
|
| notation |
CHEBI:30362 |
|
| prefixIRI |
CHEBI:30362 |
|
| prefLabel |
isopentane |
|
| smiles |
CCC(C)C |
|
| textual definition |
An alkane that is butane substituted by a methyl group at position 2. |
|
| subClassOf |