Preferred Name |
desloratadine |
|
Synonyms |
DESLORATADINE 8-chloro-11-(piperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine 8-chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo(5,6)cyclohepta(1,2-b)pyridine desloratadine descarboethoxyloratadine 8-Chloro-11-piperidin-4-ylidene-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
|
Definitions |
Loratadine in which the ethoxycarbonyl group attached to the piperidine ring is replaced by hydrogen. The major metabolite of loratidine, desloratadine is an antihistamine which is used for the symptomatic relief of allergic conditions including rhinitis and chronic urticaria. It does not readily enter the central nervous system, so does not cause drowsiness. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_291342 |
|
charge |
0 |
|
database_cross_reference |
PMID:11844681 Drug_Central:814 PMID:15482930 Wikipedia:Desloratadine KEGG:D03693 LINCS:LSM-5887 Patent:US4659716 CAS:100643-71-8 Beilstein:4263164 DrugBank:DB00967 PMID:9934454 Patent:EP208855 |
|
formula |
C19H19ClN2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48873 |
|
has_exact_synonym |
DESLORATADINE 8-chloro-11-(piperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
8-chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo(5,6)cyclohepta(1,2-b)pyridine desloratadine descarboethoxyloratadine 8-Chloro-11-piperidin-4-ylidene-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
|
has_RxCUI |
275635 |
|
id |
CHEBI:291342 |
|
in_subset | ||
inchi |
InChI=1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2 |
|
inchikey |
JAUOIFJMECXRGI-UHFFFAOYSA-N |
|
label |
desloratadine |
|
mass |
310.82100 |
|
monoisotopicmass |
310.12368 |
|
notation |
CHEBI:291342 |
|
prefixIRI |
CHEBI:291342 |
|
prefLabel |
desloratadine |
|
smiles |
Clc1ccc2c(CCc3cccnc3C2=C2CCNCC2)c1 |
|
textual definition |
Loratadine in which the ethoxycarbonyl group attached to the piperidine ring is replaced by hydrogen. The major metabolite of loratidine, desloratadine is an antihistamine which is used for the symptomatic relief of allergic conditions including rhinitis and chronic urticaria. It does not readily enter the central nervous system, so does not cause drowsiness. |
|
subClassOf |