loading...| Preferred Name |
Ergocalciferol |
|
| Synonyms |
(3S,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol Vitamin D2 vitamin D2 ergocalciferolum (3beta,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol (5Z,7E,22E)-(3S)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol (+)-vitamin D2 Vitamina D2 oleovitamin D2 ergocalciferol activated ergosterol (5Z,7E,22E)-(3S)-9,10-seco-5,7,10(19),22-ergostatetraen-3-ol Buco-D Decaps Dee-Ron Deltalin Diactol Doral Drisdol Ertron Geltabs Ostelin Radiostol Radsterin Rodine C Rodinec Sterogyl Vio-D Viosterol Vitavel-D calciferol ercalciol |
|
| Definitions |
A vitamin D supplement and has been isolated from alfalfa. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28934 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0000900 Chemspider:4444351 Patent:US2030792 PMCID:PMC6578466 MetaCyc:VITAMIN_D2 PMID:31614966 Wikipedia:Ergocalciferol Drug_Central:2838 LIPID_MAPS_instance:LMST03010001 FooDB:FDB012811 PMID:31987498 PMID:24780068 PMID:24854739 Patent:US1871136 KEGG:C05441 PMID:32784944 PMID:31199458 KEGG:D00187 CAS:50-14-6 PMID:24362707 AGR:IND605848433 Gmelin:1310395 DrugBank:DB00153 Patent:US1680818 Beilstein:1916682 Patent:US1902785 PDBeChem:D2V PMID:34302325 PPDB:107 |
|
| formula |
C28H44O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_33288 http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_alternative_id |
CHEBI:23937 CHEBI:10007 |
|
| has_exact_synonym |
(3S,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol Vitamin D2 vitamin D2 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ergocalciferolum (3beta,5Z,7E,22E)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol (5Z,7E,22E)-(3S)-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol (+)-vitamin D2 Vitamina D2 oleovitamin D2 ergocalciferol activated ergosterol (5Z,7E,22E)-(3S)-9,10-seco-5,7,10(19),22-ergostatetraen-3-ol Buco-D Decaps Dee-Ron Deltalin Diactol Doral Drisdol Ertron Geltabs Ostelin Radiostol Radsterin Rodine C Rodinec Sterogyl Vio-D Viosterol Vitavel-D calciferol ercalciol |
|
| has_RxCUI |
4018 |
|
| id |
CHEBI:28934 |
|
| in_subset | ||
| inchi |
InChI=1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-20,22,25-27,29H,4,7-8,11,14-18H2,1-3,5-6H3/b10-9+,23-12+,24-13-/t20-,22+,25-,26+,27-,28+/m0/s1 |
|
| inchikey |
MECHNRXZTMCUDQ-RKHKHRCZSA-N |
|
| label |
vitamin D2 Ergocalciferol |
|
| mass |
396.659 |
|
| monoisotopicmass |
396.33922 |
|
| notation |
CHEBI:28934 |
|
| prefixIRI |
CHEBI:28934 |
|
| prefLabel |
Ergocalciferol |
|
| smiles |
[H][C@@]1(CC[C@@]2([H])\C(CCC[C@]12C)=C\C=C1\C[C@@H](O)CCC1=C)[C@H](C)\C=C\[C@H](C)C(C)C |
|
| textual definition |
A vitamin D supplement and has been isolated from alfalfa. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36819 |