loading...| Preferred Name |
Epinephrine |
|
| Synonyms |
4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol epinephrine 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol (R)-(-)-Adnephrine (R)-(-)-Epinephrine (R)-(-)-adrenaline (-)-adrenaline (R)-(-)-Epirenamine (-)-3,4-dihydroxy-alpha-((methylamino)methyl)benzyl alcohol levoepinephrine L-Adrenaline epinephrinum (R)-(-)-Adrenaline (-)-(R)-epinephrine Adrenalin Epinephrin Epipen Epipen JR Primatene adrenaline epinefrina |
|
| Definitions |
The R-enantiomer of adrenaline. It is a hormone secreted by the adrenal glands resulting in the 'fight-or-flight' response. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28918 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23066296 PMID:23130169 MetaCyc:L-EPINEPHRINE PMID:22826982 HMDB:HMDB0000068 PMID:18325983 PMID:22429969 KEGG:C00788 PMID:23164182 PMID:23185846 PMID:21963816 PMID:22905594 PMID:22425731 PMID:22623754 PMID:22569014 KEGG:D00095 KNApSAcK:C00029643 PMID:22940899 DrugBank:DB00668 Wikipedia:Epinephrine PMID:22405854 PMID:22895980 PMID:22115931 Beilstein:2368277 PMID:22898765 CAS:51-43-4 Drug_Central:1028 Reaxys:2368277 PMID:29438107 |
|
| formula |
C9H13NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35569 http://purl.obolibrary.org/obo/CHEBI_37886 http://purl.obolibrary.org/obo/CHEBI_50513 http://purl.obolibrary.org/obo/CHEBI_35620 http://purl.obolibrary.org/obo/CHEBI_35522 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_24621 |
|
| has_alternative_id |
CHEBI:23928 CHEBI:1942 |
|
| has_exact_synonym |
4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
epinephrine 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol (R)-(-)-Adnephrine (R)-(-)-Epinephrine (R)-(-)-adrenaline (-)-adrenaline (R)-(-)-Epirenamine (-)-3,4-dihydroxy-alpha-((methylamino)methyl)benzyl alcohol levoepinephrine L-Adrenaline epinephrinum (R)-(-)-Adrenaline (-)-(R)-epinephrine Adrenalin Epinephrin Epipen Epipen JR Primatene adrenaline epinefrina |
|
| has_RxCUI |
3992 |
|
| id |
CHEBI:28918 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1 |
|
| inchikey |
UCTWMZQNUQWSLP-VIFPVBQESA-N |
|
| is conjugate base of | ||
| is enantiomer of | ||
| label |
(R)-adrenaline Epinephrine |
|
| mass |
183.20440 |
|
| monoisotopicmass |
183.08954 |
|
| notation |
CHEBI:28918 |
|
| prefixIRI |
CHEBI:28918 |
|
| prefLabel |
Epinephrine |
|
| smiles |
CNC[C@H](O)c1ccc(O)c(O)c1 |
|
| textual definition |
The R-enantiomer of adrenaline. It is a hormone secreted by the adrenal glands resulting in the 'fight-or-flight' response. |
|
| subClassOf |