Preferred Name |
N-phenylacetamide |
|
Synonyms |
acetamidobenzene acetic acid anilide Acetanilide N-acetylaminobenzene N-Acetylarylamine Acetanilid acetanil N-phenylacetamide N-Phenylacetamide |
|
Definitions |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28884 |
|
alternative term |
acetamidobenzene acetic acid anilide Acetanilide N-acetylaminobenzene N-Acetylarylamine Acetanilid acetanil N-phenylacetamide N-Phenylacetamide |
|
bearer_of | ||
charge |
0 |
|
database_cross_reference |
KEGG:C07565 UM-BBD_compID:c0657 Beilstein:606468 Drug_Central:54 Wikipedia:N-Phenylacetamide Gmelin:82833 CAS:103-84-4 PMID:23862058 Reaxys:606468 |
|
formula |
C8H9NO |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:22164 CHEBI:7331 |
|
has_exact_synonym |
N-phenylacetamide N-Phenylacetamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
acetamidobenzene acetic acid anilide Acetanilide N-acetylaminobenzene N-Acetylarylamine Acetanilid acetanil |
|
id |
CHEBI:28884 |
|
in_subset | ||
inchi |
InChI=1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
|
inchikey |
FZERHIULMFGESH-UHFFFAOYSA-N |
|
label |
N-phenylacetamide |
|
mass |
135.16320 |
|
monoisotopicmass |
135.06841 |
|
notation |
CHEBI:28884 |
|
prefLabel |
N-phenylacetamide |
|
smiles |
CC(=O)Nc1ccccc1 |
|
textual definition |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a phenyl group. |
|
subClassOf |