Preferred Name |
methacrylic acid |
|
Synonyms |
methacrylic acid 2-methylprop-2-enoic acid methylacrylic acid Methakrylsaeure alpha-methylacrylic acid 2-Methylpropensaeure Methacrylsaeure 2-methylenepropionic acid 2-methylacrylic acid alpha-methacrylic acid 2-methyl-2-propenoic acid 2-methylpropenoic acid |
|
Definitions |
An alpha,beta-unsaturated monocarboxylic acid that is acrylic acid in which the hydrogen at position 2 is substituted by a methyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25219 |
|
charge |
0 |
|
database_cross_reference |
PMID:24398912 PMID:24227222 Gmelin:49631 Wikipedia:Methacrylic_acid Reaxys:1719937 CAS:79-41-4 Beilstein:1719937 |
|
formula |
C4H6O2 |
|
has functional parent | ||
has_exact_synonym |
methacrylic acid 2-methylprop-2-enoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
methylacrylic acid Methakrylsaeure alpha-methylacrylic acid 2-Methylpropensaeure Methacrylsaeure 2-methylenepropionic acid 2-methylacrylic acid alpha-methacrylic acid 2-methyl-2-propenoic acid 2-methylpropenoic acid |
|
id |
CHEBI:25219 |
|
in_subset | ||
inchi |
InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6) |
|
inchikey |
CERQOIWHTDAKMF-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
methacrylic acid |
|
mass |
86.08924 |
|
monoisotopicmass |
86.03678 |
|
notation |
CHEBI:25219 |
|
prefLabel |
methacrylic acid |
|
smiles |
CC(=C)C(O)=O |
|
textual definition |
An alpha,beta-unsaturated monocarboxylic acid that is acrylic acid in which the hydrogen at position 2 is substituted by a methyl group. |
|
subClassOf |