Jump to:
loading...| Preferred Name |
4-amino-1,2-oxazolidin-3-one |
|
| Synonyms |
4-amino-1,2-oxazolidin-3-one cycloserine |
|
| Definitions |
A member of the class of oxazolidines that is isoxazoldin-3-one which is substituted at position 4 by an amino group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_23503 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C06682 CAS:68-39-3 |
|
| formula |
C3H6N2O2 |
|
| has_exact_synonym |
4-amino-1,2-oxazolidin-3-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
cycloserine |
|
| id |
CHEBI:23503 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6) |
|
| inchikey |
DYDCUQKUCUHJBH-UHFFFAOYSA-N |
|
| label |
4-amino-1,2-oxazolidin-3-one |
|
| mass |
102.09190 |
|
| monoisotopicmass |
102.04293 |
|
| notation |
CHEBI:23503 |
|
| prefLabel |
4-amino-1,2-oxazolidin-3-one |
|
| smiles |
NC1CONC1=O |
|
| textual definition |
A member of the class of oxazolidines that is isoxazoldin-3-one which is substituted at position 4 by an amino group. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26649 http://purl.obolibrary.org/obo/CHEBI_75606 |
Create mapping