Preferred Name |
fumaric acid |
|
Synonyms |
(2E)-but-2-enedioic acid FUMARIC ACID Fumaric acid trans-1,2-ethylenedicarboxylic acid (2E)-2-butenedioic acid trans-but-2-enedioic acid Fumarsaeure (E)-2-butenedioic acid trans-Butenedioic acid trans-ethene-1,2-dioic acid E297 |
|
Definitions |
A butenedioic acid in which the C=C double bond has E geometry. It is an intermediate metabolite in the citric acid cycle. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18012 |
|
charge |
0 |
|
database_cross_reference |
PMID:22217732 PDBeChem:FUM PMID:22113915 Drug_Central:3229 PMID:23472183 DrugBank:DB01677 CAS:110-17-8 PMID:21414846 Wikipedia:Fumaric_Acid Beilstein:605763 HMDB:HMDB0000134 KEGG:C00122 Reaxys:605763 PMID:17439666 FooDB:FDB003291 MetaCyc:FUM PMID:22516248 Gmelin:49855 KEGG:D02308 KNApSAcK:C00001183 PPDB:1347 |
|
formula |
C4H4O4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_176497 |
|
has_alternative_id |
CHEBI:42743 CHEBI:24124 CHEBI:5190 |
|
has_exact_synonym |
(2E)-but-2-enedioic acid FUMARIC ACID Fumaric acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
trans-1,2-ethylenedicarboxylic acid (2E)-2-butenedioic acid trans-but-2-enedioic acid Fumarsaeure (E)-2-butenedioic acid trans-Butenedioic acid trans-ethene-1,2-dioic acid E297 |
|
id |
CHEBI:18012 |
|
in_subset | ||
inchi |
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
|
inchikey |
VZCYOOQTPOCHFL-OWOJBTEDSA-N |
|
is conjugate acid of | ||
label |
fumaric acid |
|
mass |
116.07220 |
|
monoisotopicmass |
116.01096 |
|
notation |
CHEBI:18012 |
|
prefLabel |
fumaric acid |
|
smiles |
OC(=O)\C=C\C(O)=O |
|
textual definition |
A butenedioic acid in which the C=C double bond has E geometry. It is an intermediate metabolite in the citric acid cycle. |
|
subClassOf |