Preferred Name |
butyrate |
|
Synonyms |
butanoate butyrate propanecarboxylate CH3-[CH2]2-COO(-) 1-butanoate 1-propanecarboxylate butanoic acid, ion(1-) n-butanoate propylformate 1-butyrate butanate n-butyrate |
|
Definitions |
A short-chain fatty acid anion that is the conjugate base of butyric acid, obtained by deprotonation of the carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17968 |
|
charge |
-1 |
|
database_cross_reference |
Gmelin:324289 Reaxys:3601060 PMID:7496326 CAS:461-55-2 PMID:17190852 MetaCyc:BUTYRIC_ACID UM-BBD_compID:c0035 Beilstein:3601060 KEGG:C00246 |
|
formula |
C4H7O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_61115 |
|
has_alternative_id |
CHEBI:22946 CHEBI:13924 |
|
has_exact_synonym |
butanoate butyrate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
propanecarboxylate CH3-[CH2]2-COO(-) 1-butanoate 1-propanecarboxylate butanoic acid, ion(1-) n-butanoate propylformate 1-butyrate butanate butanoate n-butyrate |
|
id |
CHEBI:17968 |
|
in_subset | ||
inchi |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
|
inchikey |
FERIUCNNQQJTOY-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
butyrate |
|
mass |
87.09718 |
|
monoisotopicmass |
87.04515 |
|
notation |
CHEBI:17968 |
|
prefLabel |
butyrate |
|
smiles |
CCCC([O-])=O |
|
textual definition |
A short-chain fatty acid anion that is the conjugate base of butyric acid, obtained by deprotonation of the carboxy group. |
|
subClassOf |