loading...| Preferred Name |
Isopropyl Alcohol |
|
| Synonyms |
Propan-2-ol propan-2-ol ISOPROPYL ALCOHOL i-Propylalkohol Isopropanol sec-propanol isopropyl alcohol 1-methylethanol Isopropylalkohol 2-hydroxypropane 1-methylethyl alcohol Isopropyl alcohol 2-Propanol IPA i-propanol |
|
| Definitions |
A secondary alcohol that is propane in which one of the hydrogens attached to the central carbon is substituted by a hydroxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17824 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB04402 KEGG:D00137 HMDB:HMDB0000863 CAS:67-63-0 KEGG:C01845 Drug_Central:4215 KNApSAcK:C00048438 PDBeChem:IPA Beilstein:635639 PMID:24524727 UM-BBD_compID:c0519 YMDB:YMDB01718 Gmelin:1464 Reaxys:635639 PMID:24653974 Wikipedia:Isopropyl_Alcohol MetaCyc:ISO-PROPANOL |
|
| formula |
C3H8O |
|
| has role | ||
| has_alternative_id |
CHEBI:14897 CHEBI:43588 CHEBI:26280 CHEBI:8467 |
|
| has_exact_synonym |
Propan-2-ol propan-2-ol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ISOPROPYL ALCOHOL i-Propylalkohol Isopropanol sec-propanol isopropyl alcohol 1-methylethanol Isopropylalkohol 2-hydroxypropane 1-methylethyl alcohol Isopropyl alcohol 2-Propanol IPA i-propanol |
|
| has_RxCUI |
797541 |
|
| id |
CHEBI:17824 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3 |
|
| inchikey |
KFZMGEQAYNKOFK-UHFFFAOYSA-N |
|
| label |
propan-2-ol Isopropyl Alcohol |
|
| mass |
60.09502 |
|
| monoisotopicmass |
60.05751 |
|
| notation |
CHEBI:17824 |
|
| prefixIRI |
CHEBI:17824 |
|
| prefLabel |
Isopropyl Alcohol |
|
| smiles |
CC(C)O |
|
| textual definition |
A secondary alcohol that is propane in which one of the hydrogens attached to the central carbon is substituted by a hydroxy group. |
|
| subClassOf |