loading...| Preferred Name |
geraniol |
|
| Synonyms |
(2E)-3,7-dimethylocta-2,6-dien-1-ol Geraniol 2-trans-3,7-Dimethyl-2,6-octadien-1-ol (E)-geraniol (2E)-3,7-dimethyl-2,6-octadien-1-ol trans-3,7-dimethyl-2,6-octadien-1-ol (E)-3,7-dimethyl-2,6-octadien-1-ol 3,7-dimethyl-trans-2,6-octadien-1-ol trans-geraniol (2E)-geraniol geranyl alcohol (E)-nerol lemonol t-geraniol |
|
| Definitions |
A monoterpenoid consisting of two prenyl units linked head-to-tail and functionalised with a hydroxy group at its tail end. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17447 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23499697 PMID:23399806 Wikipedia:Geraniol PMID:18824010 PMID:23415329 PMID:23108028 KEGG:C01500 KNApSAcK:C00000845 CAS:106-24-1 PMID:23200656 LIPID_MAPS_instance:LMPR0102010016 PMID:23102596 PMID:20573166 PMID:23168261 PMID:23510343 Gmelin:185248 Beilstein:1722456 BPDB:2374 VSDB:2374 |
|
| formula |
C10H18O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_48318 |
|
| has_alternative_id |
CHEBI:14297 CHEBI:24219 CHEBI:5329 |
|
| has_exact_synonym |
(2E)-3,7-dimethylocta-2,6-dien-1-ol Geraniol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-trans-3,7-Dimethyl-2,6-octadien-1-ol (E)-geraniol (2E)-3,7-dimethyl-2,6-octadien-1-ol trans-3,7-dimethyl-2,6-octadien-1-ol (E)-3,7-dimethyl-2,6-octadien-1-ol 3,7-dimethyl-trans-2,6-octadien-1-ol trans-geraniol (2E)-geraniol geranyl alcohol (E)-nerol lemonol t-geraniol |
|
| has_RxCUI |
1368875 |
|
| id |
CHEBI:17447 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
|
| inchikey |
GLZPCOQZEFWAFX-JXMROGBWSA-N |
|
| label |
geraniol |
|
| mass |
154.24932 |
|
| monoisotopicmass |
154.13577 |
|
| notation |
CHEBI:17447 |
|
| prefixIRI |
CHEBI:17447 |
|
| prefLabel |
geraniol |
|
| smiles |
CC(C)=CCC\C(C)=C\CO |
|
| textual definition |
A monoterpenoid consisting of two prenyl units linked head-to-tail and functionalised with a hydroxy group at its tail end. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_15734 |