loading...| Preferred Name |
Pyridoxal |
|
| Synonyms |
3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carbaldehyde Pyridoxal pyridoxal pyridoxaldehyde 3-HYDROXY-5-(HYDROXYMETHYL)-2-METHYLISONICOTINALDEHYDE |
|
| Definitions |
A pyridinecarbaldehyde that is pyridine-4-carbaldehyde bearing methyl, hydroxy and hydroxymethyl substituents at positions 2, 3 and 5 respectively. The 4-carboxyaldehyde form of vitamin B6, it is converted into pyridoxal phosphate, a coenzyme for the synthesis of amino acids, neurotransmitters, sphingolipids and aminolevulinic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17310 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0001545 Wikipedia:Pyridoxal PMID:17765195 PMID:12001008 MetaCyc:PYRIDOXAL PMID:31915818 PMID:6853710 PMID:16710308 PMID:23801094 PMID:7440576 KNApSAcK:C00007509 Chemspider:1021 PMID:16495081 PDBeChem:PXL PMID:20381632 KEGG:C00250 PMID:1621875 Reaxys:383768 PMID:24365359 Drug_Central:4134 PMID:150790 PMID:4051187 PMID:22770225 PMID:433818 PMID:8116826 DrugBank:DB00147 Beilstein:383768 Gmelin:218674 PMID:3663392 PMID:7159754 CAS:66-72-8 |
|
| formula |
C8H9NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:26423 CHEBI:45112 CHEBI:14976 CHEBI:8667 |
|
| has_exact_synonym |
3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carbaldehyde Pyridoxal pyridoxal |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pyridoxaldehyde 3-HYDROXY-5-(HYDROXYMETHYL)-2-METHYLISONICOTINALDEHYDE |
|
| has_RxCUI |
9002 |
|
| id |
CHEBI:17310 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H9NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,4,10,12H,3H2,1H3 |
|
| inchikey |
RADKZDMFGJYCBB-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
Pyridoxal pyridoxal |
|
| mass |
167.16200 |
|
| monoisotopicmass |
167.05824 |
|
| notation |
CHEBI:17310 |
|
| prefixIRI |
CHEBI:17310 |
|
| prefLabel |
Pyridoxal |
|
| smiles |
[H]C(=O)c1c(CO)cnc(C)c1O |
|
| textual definition |
A pyridinecarbaldehyde that is pyridine-4-carbaldehyde bearing methyl, hydroxy and hydroxymethyl substituents at positions 2, 3 and 5 respectively. The 4-carboxyaldehyde form of vitamin B6, it is converted into pyridoxal phosphate, a coenzyme for the synthesis of amino acids, neurotransmitters, sphingolipids and aminolevulinic acid. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_27306 http://purl.obolibrary.org/obo/CHEBI_38187 http://purl.obolibrary.org/obo/CHEBI_38182 |