Preferred Name |
Sarcosine |
|
Synonyms |
SARCOSINE Sarcosine sarcosine sarcosinic acid (methylamino)acetic acid L-sarcosine N-Methylglycine methylaminoacetic acid N-methylaminoacetic acid (methylamino)ethanoic acid MeGly Sar |
|
Definitions |
A N-alkylglycine that is the N-methyl derivative of glycine. It is an intermediate in the metabolic pathway of glycine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15611 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:1699442 Beilstein:1699442 UM-BBD_compID:c0135 Gmelin:2018 PMID:15023571 PMID:17190852 PMID:11850512 HMDB:HMDB0000271 PMID:19944746 PMID:11272730 CAS:107-97-1 PMID:19577367 PDBeChem:SAR Wikipedia:Sarcosine PMID:17901997 KEGG:C00213 PMID:19619564 PMID:15331688 PMID:16154544 MetaCyc:SARCOSINE PMID:17095900 PMID:19433577 |
|
formula |
C3H7NO2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_64589 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
has_alternative_id |
CHEBI:15065 CHEBI:10876 CHEBI:21765 CHEBI:45442 CHEBI:45614 CHEBI:45381 CHEBI:45531 CHEBI:12609 CHEBI:9029 |
|
has_exact_synonym |
SARCOSINE Sarcosine sarcosine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
sarcosinic acid (methylamino)acetic acid L-sarcosine N-Methylglycine methylaminoacetic acid N-methylaminoacetic acid (methylamino)ethanoic acid MeGly Sar |
|
has_RxCUI |
1362906 |
|
id |
CHEBI:15611 |
|
in_subset | ||
inchi |
InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) |
|
inchikey |
FSYKKLYZXJSNPZ-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
Sarcosine sarcosine |
|
mass |
89.09322 |
|
monoisotopicmass |
89.04768 |
|
notation |
CHEBI:15611 |
|
prefixIRI |
CHEBI:15611 |
|
prefLabel |
Sarcosine |
|
smiles |
CNCC(O)=O |
|
textual definition |
A N-alkylglycine that is the N-methyl derivative of glycine. It is an intermediate in the metabolic pathway of glycine. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_21760 |