Preferred Name |
LEVOMENTHOL |
|
Synonyms |
(-)-menthol (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol (-)-Menthol (-)-(1R,3R,4S)-menthol levomentholum (1R-(1-alpha,2-beta,5-alpha))-5-methyl-2-(1-methylethyl)cyclohexanol (1alpha,2beta,5alpha)-5-methyl-2(1-methylethyl)cyclohexanol levomenthol (1R,3R,4S)-(-)-menthol L-Menthol l-menthol levomentol |
|
Definitions |
A p-menthan-3-ol which has (1R,2S,5R)-stereochemistry. It is the most common naturally occurring enantiomer. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15409 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Menthol LIPID_MAPS_instance:LMPR0102090001 PMID:18640225 PMID:21353674 Reaxys:1902293 KEGG:C00400 CAS:2216-51-5 Drug_Central:934 PMID:17498839 PMID:23963768 Patent:CN101602651 PMID:22218824 KEGG:D00064 PMID:17021997 PMID:7974298 KNApSAcK:C00000810 HMDB:HMDB0003352 PMID:22348831 MetaCyc:--MENTHOL PMID:23800946 DrugBank:DB00825 Patent:US2011313205 |
|
formula |
C10H20O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_53784 |
|
has_alternative_id |
CHEBI:10779 CHEBI:18493 CHEBI:101 |
|
has_exact_synonym |
(-)-menthol (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexan-1-ol (-)-Menthol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(-)-(1R,3R,4S)-menthol levomentholum (1R-(1-alpha,2-beta,5-alpha))-5-methyl-2-(1-methylethyl)cyclohexanol (1alpha,2beta,5alpha)-5-methyl-2(1-methylethyl)cyclohexanol levomenthol (1R,3R,4S)-(-)-menthol L-Menthol l-menthol levomentol |
|
has_RxCUI |
236388 |
|
id |
CHEBI:15409 |
|
in_subset | ||
inchi |
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
|
inchikey |
NOOLISFMXDJSKH-KXUCPTDWSA-N |
|
is enantiomer of | ||
label |
(-)-menthol LEVOMENTHOL |
|
mass |
156.26520 |
|
monoisotopicmass |
156.15142 |
|
notation |
CHEBI:15409 |
|
prefixIRI |
CHEBI:15409 |
|
prefLabel |
LEVOMENTHOL |
|
smiles |
CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
|
textual definition |
A p-menthan-3-ol which has (1R,2S,5R)-stereochemistry. It is the most common naturally occurring enantiomer. |
|
subClassOf |